CAS 56816-60-5
:Abequose
Description:
Abequose, with the CAS number 56816-60-5, is a synthetic carbohydrate that belongs to the class of sugars known as deoxy sugars. It is characterized by its unique structural features, which include a modified sugar backbone that contributes to its biological activity. Abequose is known for its potential applications in the pharmaceutical and food industries, particularly due to its ability to influence glycosylation processes and its role as a potential prebiotic. The substance is typically white to off-white in appearance and is soluble in water, making it suitable for various formulations. Its sweetness profile and stability under different conditions make it an interesting candidate for research into alternative sweeteners. Additionally, studies have indicated that Abequose may exhibit certain health benefits, such as modulating gut microbiota and enhancing metabolic functions. However, further research is necessary to fully understand its properties and potential applications in various fields.
Formula:C6H12O4
InChI:InChI=1S/C6H12O4/c1-4(8)6(10)2-5(9)3-7/h3-6,8-10H,2H2,1H3/t4-,5-,6-/m1/s1
InChI key:InChIKey=GNTQICZXQYZQNE-HSUXUTPPSA-N
SMILES:C([C@H]([C@@H](C)O)O)[C@H](C=O)O
Synonyms:- 3,6-Dideoxy-<span class="text-smallcaps">D</span>-xylo-hexose
- 644-48-4
- <span class="text-smallcaps">D</span>-Abequose
- <span class="text-smallcaps">D</span>-xylo-Hexose, 3,6-dideoxy-
- Abequose
- D-Abequose
- 3,6-Dideoxy-D-xylo-hexose
- D-xylo-Hexose, 3,6-dideoxy-
- 3,6-Dideoxy-D-xylo-hexopyranose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
D-Abequose
CAS:Controlled ProductApplications D-Abequose is a sweetener and flavor enhancer formulations for food, beverage, pharmaceutical and cosmetic uses
References Karanewsky,D.S., et al.: U.S. Pat. Appl. Publ. (2017), US 20170105432 A1 20170420Formula:C6H12O4Color and Shape:NeatMolecular weight:148.16D-Abequose
CAS:D-Abequose is a monosaccharide that is a rare type of deoxy sugar. It is typically derived from certain bacterial polysaccharides. This sugar is characterized by the absence of an oxygen atom at the second carbon of the molecule, giving it distinctive structural properties. The mode of action of D-Abequose involves its role as a component in the O-antigen of gram-negative bacteria, where it contributes to the structural uniqueness and immunogenic properties of the bacterial polysaccharides.Formula:C6H12O4Purity:Min. 95%Molecular weight:148.16 g/mol


