CAS 5682-25-7
:alpha-adenosine
Description:
Alpha-adenosine, also known as adenosine, is a purine nucleoside composed of an adenine base attached to a ribose sugar. It plays a crucial role in various biochemical processes, including energy transfer, signal transduction, and regulation of physiological functions. The CAS number 5682-25-7 specifically refers to a particular stereoisomer of adenosine, which is characterized by its ability to bind to adenosine receptors in the body, influencing cardiovascular, neurological, and immune responses. Alpha-adenosine is known for its vasodilatory effects, promoting blood flow and reducing heart rate, making it significant in pharmacology and medicine. Additionally, it is involved in the modulation of neurotransmitter release and has potential therapeutic applications in conditions such as arrhythmias and certain types of ischemia. The substance is typically soluble in water and exhibits a relatively low toxicity profile, although its effects can vary based on dosage and individual physiological conditions. Overall, alpha-adenosine is a vital compound in both biological systems and therapeutic contexts.
Formula:C24H16ClNO4S2
InChI:InChI=1/C24H16ClNO4S2/c1-29-20-13-15(7-12-19(20)30-23(28)16-8-10-17(25)11-9-16)14-21-22(27)26(24(31)32-21)18-5-3-2-4-6-18/h2-14H,1H3/b21-14+
Synonyms:- 9H-Purin-6-amine, 9-alpha-D-ribofuranosyl-
- 9-(alpha-L-ribofuranosyl)-9H-purin-6-amine
- 2-methoxy-4-[(E)-(4-oxo-3-phenyl-2-thioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl 4-chlorobenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
9-α-D-Ribofuranosyl-9H-purin-6-amine
CAS:Formula:C10H13N5O4Purity:99%Color and Shape:SolidMolecular weight:267.2413(2S,3R,4S,5R)-2-(6-Amino-9H-purin-9-yl)-5-(hydroxymethyl)tetrahydrofuran-3,4-diol
CAS:(2S,3R,4S,5R)-2-(6-Amino-9H-purin-9-yl)-5-(hydroxymethyl)tetrahydrofuran-3,4-diolPurity:99%Molecular weight:267.25g/molα-Adenosine
CAS:alpha-Adenosine is a useful organic compound for research related to life sciences. The catalog number is TNU1637 and the CAS number is 5682-25-7.Formula:C10H13N5O4Color and Shape:SolidMolecular weight:267.24a-Adenosine
CAS:<p>a-Adenosine is a nucleoside that has been shown to have anti-cancer properties. It inhibits the proliferation of squamous carcinoma cells by irreversibly inhibiting adenosine deaminase, which converts adenosine to inosine, as well as other enzymes such as DNA polymerase and ribonucleotide reductase. The reaction mechanism for this inhibition is not yet fully understood, but it may be related to the inhibition of camp levels or receptor activity. a-Adenosine has also been shown to have anti-microbial properties against bacteria, fungi and yeast. It inhibits the growth of these microorganisms by binding to their cell walls and preventing protein synthesis. This drug is rapidly hydrolyzed in vivo and has an antimicrobial effect at physiological concentrations.<br>A more potent analog of a-adenosine (a-adenosinium) has been developed that can inhibit epidermal growth factor (EGF).</p>Formula:C10H13N5O4Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:267.24 g/mol





