CAS 56843-79-9

4-Chloro-2-methylthieno[2,3-d]pyrimidine

Description:

4-Chloro-2-methylthieno[2,3-d]pyrimidine is a heterocyclic compound characterized by its fused thieno and pyrimidine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 4-position and a methyl group at the 2-position of the pyrimidine ring influences its reactivity and solubility. This compound typically exhibits moderate polarity due to the electronegative chlorine substituent, which can participate in various chemical interactions. It is often utilized in medicinal chemistry and pharmaceutical research, particularly for its potential biological activities, including antimicrobial and anticancer properties. The compound's structure allows for various functionalization possibilities, making it a valuable intermediate in organic synthesis. Additionally, its stability under standard laboratory conditions makes it suitable for further chemical modifications. As with many heterocycles, it may also exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization in research settings.

Formula: C₇H₅ClN₂S

InChI: InChI=1/C7H5ClN2S/c1-4-9-6(8)5-2-3-11-7(5)10-4/h2-3H,1H3

SMILES: Cc1nc(c2ccsc2n1)Cl

Synonyms:

• Thieno[2,3-D]Pyrimidine, 4-Chloro-2-Methyl-

4-CHLORO-2-METHYL-THIENO[2,3-D]PYRIMIDINE

CAS: 56843-79-9

Formula: C₇H₅ClN₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 184.6460

Ref: IN-DA00E8ZI

4-Chloro-2-methylthieno[2,3-d]pyrimidine

CAS: 56843-79-9

4-Chloro-2-methylthieno[2,3-d]pyrimidine

Purity: 95%

Molecular weight: 184.65g/mol

Ref: 54-OR932569

4-Chloro-2-methylthieno[2,3-d]pyrimidine

CAS: 56843-79-9

Formula: C₇H₅ClN₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 184.64

Ref: 10-F067566

4-Chloro-2-methylthieno[2,3-d]pyrimidine

Controlled Product

CAS: 56843-79-9

Applications 4-chloro-2-methylthieno[2,3-d]pyrimidine (cas# 56843-79-9) is a useful research chemical.

Formula: C₇H₅ClN₂S

Color and Shape: Neat

Molecular weight: 184.65

Ref: TR-C368935