CAS 56844-11-2

4-Chloro-2-ethylthieno[2,3-d]pyrimidine

Description:

4-Chloro-2-ethylthieno[2,3-d]pyrimidine is a heterocyclic compound characterized by its unique structure, which includes a thieno[2,3-d]pyrimidine core with a chloro substituent at the 4-position and an ethyl group at the 2-position. This compound typically exhibits properties common to heterocycles, such as moderate solubility in organic solvents and potential reactivity due to the presence of the chlorine atom, which can participate in nucleophilic substitution reactions. Its thieno and pyrimidine components contribute to its potential biological activity, making it of interest in pharmaceutical research. The compound may also display specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Additionally, its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, safety and handling precautions should be observed, as with any chemical substance, due to the presence of chlorine and the potential for biological activity.

Formula: C₈H₇ClN₂S

InChI: InChI=1/C8H7ClN2S/c1-2-6-10-7(9)5-3-4-12-8(5)11-6/h3-4H,2H2,1H3

SMILES: CCc1nc(c2ccsc2n1)Cl

Synonyms:

• Thieno[2,3-D]Pyrimidine, 4-Chloro-2-Ethyl-

4-chloro-2-ethylthieno[2,3-d]pyrimidine

CAS: 56844-11-2

Formula: C₈H₇ClN₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 198.6726

Ref: IN-DA00EJWU

4-Chloro-2-ethylthieno[2,3-d]pyrimidine

CAS: 56844-11-2

4-Chloro-2-ethylthieno[2,3-d]pyrimidine

Purity: 98%

Molecular weight: 198.68g/mol

Ref: 54-OR1059527

4-Chloro-2-ethylthieno[2,3-d]pyrimidine

CAS: 56844-11-2

Purity: 98%

Molecular weight: 198.6699982

Ref: 10-F646503

4-Chloro-2-ethylthieno[2,3-d]pyrimidine

CAS: 56844-11-2

Versatile small molecule scaffold

Formula: C₈H₇ClN₂S

Purity: Min. 95%

Molecular weight: 198.67 g/mol

Ref: 3D-GCA84411