CAS 56845-87-5
:(3β,25R)-3-Hydroxycholest-5-en-26-oic acid
Description:
(3β,25R)-3-Hydroxycholest-5-en-26-oic acid, also known as 3-hydroxycholestenoic acid, is a sterol derivative characterized by its hydroxyl group at the 3-position and a carboxylic acid functional group at the 26-position of the cholesterol backbone. This compound is part of the steroid family and exhibits a complex structure that includes multiple rings and a double bond, contributing to its biological activity. It is typically found in various biological systems and is involved in metabolic pathways related to cholesterol and steroid hormone synthesis. The presence of the hydroxyl and carboxylic acid groups enhances its solubility in polar solvents, influencing its interactions within biological membranes and its role in cellular signaling. Additionally, this compound may have implications in research related to lipid metabolism and cardiovascular health. Its CAS number, 56845-87-5, is a unique identifier that facilitates its identification in scientific literature and databases.
Formula:C27H44O3
InChI:InChI=1S/C27H44O3/c1-17(6-5-7-18(2)25(29)30)22-10-11-23-21-9-8-19-16-20(28)12-14-26(19,3)24(21)13-15-27(22,23)4/h8,17-18,20-24,28H,5-7,9-16H2,1-4H3,(H,29,30)/t17-,18-,20+,21+,22-,23+,24+,26+,27-/m1/s1
InChI key:InChIKey=WVXOMPRLWLXFAP-KQOPCUSDSA-N
SMILES:C[C@@]12[C@]([C@]3([C@@]([C@]4(C)C(=CC3)C[C@@H](O)CC4)(CC1)[H])[H])(CC[C@@]2([C@@H](CCC[C@H](C(O)=O)C)C)[H])[H]
Synonyms:- (3β,25R)-3-Hydroxycholest-5-en-26-oic acid
- Cholest-5-en-26-oic acid, 3-hydroxy-, (3β,25R)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
5-Cholestene-26-oic acid-3β-ol
CAS:5-Cholestene-26-oic acid-3β-ol is a cholesterol catabolite [1] .Formula:C27H44O3Color and Shape:SolidMolecular weight:416.64(3β,25R)-Hydroxy-5-cholestenoic Acid
CAS:Controlled ProductFormula:C27H44O3Color and Shape:NeatMolecular weight:416.637(3β,25R)-Hydroxy-5-cholestenoic acid
CAS:Controlled ProductThe cholesterol 25-hydroxylase (CYP7A1) is an enzyme that catalyzes the conversion of cholesterol to bile acids and is a key regulatory enzyme in the biosynthesis of bile acids. Mutations in CYP7A1 have been associated with atherosclerotic cardiovascular disease. The human CYP7A1 gene encodes a protein which contains several transcription factor response elements, including those for Sp1 and AP-2. The CYP7A1 gene also contains binding sites for nuclear receptors, such as PPARα, which regulate its expression. This gene product is involved in cholesterol metabolism by converting it to bile acids and has shown to be regulated by PPARα.Formula:C27H44O3Purity:Min. 95%Color and Shape:PowderMolecular weight:416.64 g/mol


