CAS 5685-17-6

2-[(4-Methyl-2-thiazolyl)thio]acetic acid

Description:

2-[(4-Methyl-2-thiazolyl)thio]acetic acid, with the CAS number 5685-17-6, is an organic compound characterized by its thiazole ring and thiol functional group. This substance typically appears as a solid or crystalline material and is soluble in polar solvents due to the presence of the carboxylic acid group. The thiazole moiety contributes to its potential biological activity, making it of interest in pharmaceutical research. The compound may exhibit properties such as antimicrobial or antifungal activity, which are common in thiazole derivatives. Its molecular structure includes a methyl group that enhances its lipophilicity, potentially influencing its interaction with biological systems. Additionally, the presence of the thiol group can facilitate various chemical reactions, including nucleophilic substitutions and redox reactions. Overall, 2-[(4-Methyl-2-thiazolyl)thio]acetic acid is a compound of interest in both synthetic organic chemistry and medicinal chemistry due to its unique structural features and potential applications.

Formula: C₆H₇NO₂S₂

InChI: InChI=1S/C6H7NO2S2/c1-4-2-10-6(7-4)11-3-5(8)9/h2H,3H2,1H3,(H,8,9)

InChI key: InChIKey=SMTQOYIRMDGTAY-UHFFFAOYSA-N

SMILES: S(CC(O)=O)C1=NC(C)=CS1

Synonyms:

• (4-Methyl-thiazol-2-ylsulfanyl)-acetic acid
• 2-[(4-Methyl-1,3-thiazol-2-yl)sulfanyl]acetic acid
• 2-[(4-Methyl-2-thiazolyl)thio]acetic acid
• Acetic acid, 2-[(4-methyl-2-thiazolyl)thio]-
• Acetic acid, [(4-methyl-2-thiazolyl)thio]-
• S-(4-Methyl-2-thiazolyl)thioglycolic acid
• [(4-Methyl-1,3-Thiazol-2-Yl)Thio]Acetic Acid
• [(4-Methyl-1,3-thiazol-2-yl)sulfanyl]acetic acid

[(4-Methyl-1,3-thiazol-2-yl)thio]acetic acid

CAS: 5685-17-6

Formula: C₆H₇NO₂S₂

Molecular weight: 189.2553

Ref: IN-DA00EAW6

(4-Methyl-thiazol-2-ylsulfanyl)-acetic acid

CAS: 5685-17-6

Formula: C₆H₇NO₂S₂

Purity: 95.0%

Molecular weight: 189.25

Ref: 10-F027345