CAS 56850-91-0
:methyl 4-(2-bromoethoxy)benzoate
Description:
Methyl 4-(2-bromoethoxy)benzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid and methanol. It features a benzene ring substituted at the para position with a 2-bromoethoxy group, contributing to its unique chemical properties. The presence of the bromine atom enhances its reactivity, making it useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. This compound is typically a colorless to pale yellow liquid with a moderate boiling point and is soluble in organic solvents. Its molecular structure allows for potential interactions in nucleophilic substitution reactions, and it may serve as an intermediate in the synthesis of more complex molecules. Additionally, due to the presence of the bromine atom, it may exhibit specific biological activities, making it of interest in pharmaceutical research. Safety precautions should be taken when handling this compound, as brominated compounds can pose health risks.
Formula:C10H11BrO3
InChI:InChI=1/C10H11BrO3/c1-13-10(12)8-2-4-9(5-3-8)14-7-6-11/h2-5H,6-7H2,1H3
SMILES:COC(=O)c1ccc(cc1)OCCBr
Synonyms:- Benzoic acid, 4-(2-bromoethoxy)-, methyl ester
- Methyl 4-(2-bromoethoxy)benzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl 4-(2-Bromoethoxy)Benzenecarboxylate
CAS:Formula:C10H11BrO3Purity:95%Color and Shape:SolidMolecular weight:259.0965Methyl 4-(2-bromoethoxy)benzoate
CAS:Methyl 4-(2-bromoethoxy)benzoateFormula:C10H11BrO3Purity:98%Color and Shape: solidMolecular weight:259.09654g/molMethyl 4-(2-bromoethoxy)benzenecarboxylate
CAS:Methyl 4-(2-bromoethoxy)benzenecarboxylate is a histamine receptor antagonist that has been shown to be active at the histamine H3 receptor. Methyl 4-(2-bromoethoxy)benzenecarboxylate can be used to treat depression and other disorders related to histamine, such as allergic reactions. This drug has also been shown to inhibit serotonin reuptake by acting on the serotonin transporter, thereby increasing serotonin levels in the brain. Methyl 4-(2-bromoethoxy)benzenecarboxylate is an effective drug for the treatment of depression with few side effects.Formula:C10H11BrO3Purity:Min. 95%Molecular weight:259.1 g/mol


