CAS 568565-86-6
:4-(4-Fluorophenoxy)benzylamine hydrochloride
Description:
4-(4-Fluorophenoxy)benzylamine hydrochloride is a chemical compound characterized by its structural features, which include a benzylamine core substituted with a 4-fluorophenoxy group. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and methanol, which is common for many amine hydrochlorides. The presence of the fluorine atom in the para position of the phenoxy group can influence the compound's electronic properties and biological activity, potentially enhancing its lipophilicity and reactivity. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways. However, safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Always refer to safety data sheets and relevant literature for detailed information on handling and applications.
Formula:C13H13ClFNO
InChI:InChI=1/C13H12FNO.ClH/c14-11-3-7-13(8-4-11)16-12-5-1-10(9-15)2-6-12;/h1-8H,9,15H2;1H
SMILES:c1cc(ccc1CN)Oc1ccc(cc1)F.Cl
Synonyms:- 1-[4-(4-Fluorophenoxy)Phenyl]Methanamine Hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(4-(4-Fluorophenoxy)phenyl)methanamine hydrochloride
CAS:Formula:C13H13ClFNOColor and Shape:SolidMolecular weight:253.69984-(4-Fluorophenoxy)benzylamine hydrochloride
CAS:4-(4-Fluorophenoxy)benzylamine hydrochloride is a metabolic agent that inhibits the metabolism of phenylpropionic acid and butanoic acid. It is used industrially as an oxime to protect other organic compounds from damage by peroxides, such as in polymerization reactions. 4-(4-Fluorophenoxy)benzylamine hydrochloride has been shown to be effective in treating metabolic diseases, such as phenylketonuria and urea cycle disorders.Formula:C13H12FNO·HClPurity:Min. 95%Color and Shape:PowderMolecular weight:253.7 g/mol1-[4-(4-fluorophenoxy)phenyl]methanamine hydrochloride
CAS:Formula:C13H13ClFNOPurity:95.0%Molecular weight:253.7


