
CAS 56857-66-0
:Agavoside B
Description:
Agavoside B, with the CAS number 56857-66-0, is a natural glycoside derived from the Agave plant, particularly known for its presence in Agave americana. This compound is characterized by its complex structure, which typically includes a sugar moiety linked to a non-sugar aglycone. Agavoside B exhibits various biological activities, including potential antioxidant and anti-inflammatory properties, making it of interest in pharmacological research. Its solubility is generally influenced by the presence of the sugar component, which can enhance its bioavailability. Additionally, Agavoside B may contribute to the flavor profile of Agave-based products, such as tequila and agave syrup. The compound's stability and reactivity can vary depending on environmental conditions, such as pH and temperature. As research continues, the full range of its therapeutic potential and applications in food and medicine is being explored, highlighting the importance of natural products in drug discovery and development.
Formula:C39H62O14
InChI:InChI=1S/C39H62O14/c1-17-7-10-39(48-16-17)18(2)28-24(53-39)12-23-21-6-5-19-11-20(8-9-37(19,3)22(21)13-27(42)38(23,28)4)49-35-33(47)31(45)34(26(15-41)51-35)52-36-32(46)30(44)29(43)25(14-40)50-36/h17-26,28-36,40-41,43-47H,5-16H2,1-4H3/t17-,18+,19+,20+,21-,22+,23+,24+,25-,26-,28+,29-,30+,31-,32-,33-,34+,35-,36+,37+,38-,39-/m1/s1
InChI key:InChIKey=YEKZYRCPUZIPAI-FKPXPTAZSA-N
SMILES:C[C@@]12[C@@]3([C@@](O[C@@]4([C@H]3C)CC[C@@H](C)CO4)(C[C@]1([C@]5([C@](CC2=O)([C@]6(C)[C@@](CC5)(C[C@@H](O[C@@H]7O[C@H](CO)[C@H](O[C@@H]8O[C@H](CO)[C@@H](O)[C@H](O)[C@H]8O)[C@H](O)[C@H]7O)CC6)[H])[H])[H])[H])[H])[H]
Synonyms:- (3β,5α,25R)-3-[(4-O-β-D-Glucopyranosyl-β-D-galactopyranosyl)oxy]spirostan-12-one
- Agavoside B
- Spirostan-12-one, 3-[(4-O-β-D-glucopyranosyl-β-D-galactopyranosyl)oxy]-, (3β,5α,25R)-
- Hecogenin 3-O-β-D-glucopyranosyl-(1→4)-β-D-galactopyranoside
- TTS 8
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Agavoside B
CAS:<p>Agavoside B is a biochemical.</p>Formula:C39H62O14Color and Shape:SolidMolecular weight:754.90
