CAS 56879-46-0
:pyrrolidin-2-ylacetic acid
Description:
Pyrrolidin-2-ylacetic acid, with the CAS number 56879-46-0, is an organic compound characterized by its pyrrolidine ring structure and an acetic acid functional group. This compound features a five-membered nitrogen-containing heterocycle, which contributes to its unique chemical properties. Pyrrolidin-2-ylacetic acid is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid group. It exhibits both basic and acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. This compound is of interest in medicinal chemistry and pharmacology, as it may exhibit biological activity related to neurotransmitter modulation or other physiological effects. Its derivatives and analogs are often explored for potential therapeutic applications. As with many organic compounds, handling should be done with care, following appropriate safety protocols to mitigate any risks associated with its use.
Formula:C6H11NO2
InChI:InChI=1/C6H11NO2/c8-6(9)4-5-2-1-3-7-5/h5,7H,1-4H2,(H,8,9)
SMILES:C1CC(CC(=O)O)NC1
Synonyms:- (+/-)-Homoproline
- 2-Pyrrolidineacetic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(Pyrrolidin-2-yl)acetic acid
CAS:Formula:C6H11NO2Purity:95.0%Color and Shape:SolidMolecular weight:129.159(+/-)-Homoproline
CAS:Controlled Product<p>Applications It was isolated from Melampodium divaricatum; a new GABA-uptake inhibitor derived from proline.<br>References Dann, A., et al.: Nature, 186, 1051 (1960), Passreiter, C., et al.: Planta Med., 58, 556 (1992), Roeder, E., et al.: Pharmazie, 48, 953 (1993), Wernery, U., et al.: Fitoterapia, 68, 278 (1997),<br></p>Formula:C6H11NO2Color and Shape:NeatMolecular weight:129.16(+/-)-Homoproline
CAS:(+/-)-Homoproline is a GABA-uptake inhibitor derived from proline.Formula:C6H11NO2Color and Shape:SolidMolecular weight:129.16



