CAS 56881-31-3
:7-aminothieno[2,3-b]pyrazine-6-carboxylic acid
Description:
7-Aminothieno[2,3-b]pyrazine-6-carboxylic acid is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both thieno and pyrazine moieties. This compound features an amino group and a carboxylic acid functional group, which contribute to its potential as a versatile building block in medicinal chemistry and organic synthesis. The presence of the thieno and pyrazine rings imparts specific electronic and steric properties, making it of interest in various applications, including pharmaceuticals and agrochemicals. Its solubility and reactivity can be influenced by the functional groups attached to the core structure, allowing for modifications that enhance its biological activity or facilitate its incorporation into larger molecular frameworks. The compound's CAS number, 56881-31-3, serves as a unique identifier in chemical databases, aiding in the retrieval of information regarding its synthesis, properties, and potential applications. Overall, 7-aminothieno[2,3-b]pyrazine-6-carboxylic acid exemplifies the complexity and utility of heterocyclic compounds in modern chemistry.
Formula:C7H5N3O2S
InChI:InChI=1/C7H5N3O2S/c8-3-4-6(10-2-1-9-4)13-5(3)7(11)12/h1-2H,8H2,(H,11,12)
SMILES:c1cnc2c(c(c(C(=O)O)s2)N)n1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
7-AMINOTHIENO[2,3-B]PYRAZINE-6-CARBOXYLIC ACID
CAS:Formula:C7H5N3O2SPurity:98%Color and Shape:SolidMolecular weight:195.19857-Aminothieno[2,3-b]pyrazine-6-carboxylic acid
CAS:7-Aminothieno[2,3-b]pyrazine-6-carboxylic acidPurity:≥95%Color and Shape:SolidMolecular weight:195.20g/mol7-Aminothieno[2,3-b]pyrazine-6-carboxylic acid
CAS:<p>7-Aminothieno[2,3-b]pyrazine-6-carboxylic acid is an organic solvent that is soluble in water. It has a nitrogen atom, two silver atoms and a fatty acid. This compound has shown to have insulin resistance properties when it was expressed in mice and rats. 7-Aminothieno[2,3-b]pyrazine-6-carboxylic acid also has the ability to inhibit the growth of bacteria. It binds to silver halide and halide ions, which are found in tissues, and can be used as a contrast agent for X-rays or MRI scans of tissues.</p>Formula:C7H5N3O2SPurity:Min. 95%Molecular weight:195.2 g/mol



