CAS 56883-05-7
:N-[(4-methoxyphenyl)carbonyl]-9-pentofuranosyl-9H-purin-6-amine
Description:
N-[(4-methoxyphenyl)carbonyl]-9-pentofuranosyl-9H-purin-6-amine, with the CAS number 56883-05-7, is a chemical compound that belongs to the class of purine derivatives. This substance features a purine base structure, which is a fundamental component of nucleic acids, and is modified with a pentofuranosyl sugar moiety, enhancing its biological relevance. The presence of a 4-methoxyphenylcarbonyl group indicates that it has an aromatic substitution, which can influence its solubility and reactivity. The compound is likely to exhibit properties typical of purine analogs, such as potential interactions with biological macromolecules, making it of interest in medicinal chemistry and pharmacology. Its structural characteristics suggest it may participate in hydrogen bonding and π-π stacking interactions, which are crucial for nucleic acid interactions. Additionally, the presence of an amine group may contribute to its basicity and reactivity in various chemical environments. Overall, this compound's unique structure positions it as a candidate for further research in drug development and biochemical applications.
Formula:C18H19N5O6
InChI:InChI=1/C18H19N5O6/c1-28-10-4-2-9(3-5-10)17(27)22-15-12-16(20-7-19-15)23(8-21-12)18-14(26)13(25)11(6-24)29-18/h2-5,7-8,11,13-14,18,24-26H,6H2,1H3,(H,19,20,22,27)
SMILES:COc1ccc(cc1)C(=O)Nc1c2c(ncn1)n(cn2)C1C(C(C(CO)O1)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
N6-(4-Methyoxybenzoyl)adenosine
CAS:N6-(4-Methoxybenzoyl)adenosine is an adenine base that is a furanose sugar, with a glycosidic bond. The furanose ring has a phenyl group and an adenine base in the conformation of pyranose. The phenyl ring is in the geometry of chair form and is bonded to the 6' position of the adenosine base. N6-(4-Methoxybenzoyl)adenosine has a glycosidic bond at C1' - C5'. It has an angstrom distance between C1'-C2' and C3'-C5'.
Formula:C18H19N5O6Purity:Min. 95%Molecular weight:401.37 g/mol

