CAS 56883-33-1
:Tetraacetylazidodeoxyglucopyranose
Description:
Tetraacetylazidodeoxyglucopyranose is a chemical compound that belongs to the class of azido sugars, which are modified carbohydrates featuring an azide functional group. This compound is characterized by the presence of four acetyl groups attached to the hydroxyl groups of deoxyglucopyranose, enhancing its stability and solubility in organic solvents. The azide group (-N3) is notable for its reactivity, particularly in click chemistry applications, allowing for the formation of various bioconjugates. Tetraacetylazidodeoxyglucopyranose is typically used in biochemical research, particularly in glycosylation reactions and the synthesis of glycoproteins or glyconjugates. Its structural features contribute to its utility in studying carbohydrate interactions and in the development of glycomimetics. The compound is generally handled with standard laboratory safety precautions due to the presence of the azide group, which can be hazardous under certain conditions. Overall, tetraacetylazidodeoxyglucopyranose serves as a valuable tool in the field of chemical biology and synthetic chemistry.
Formula:C14H19N3O9
InChI:InChI=1/C14H19N3O9/c1-6(18)22-5-10-12(23-7(2)19)13(24-8(3)20)11(16-17-15)14(26-10)25-9(4)21/h10-14H,5H2,1-4H3/t10-,11-,12-,13-,14+/m1/s1
Synonyms:- 1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-alpha-D-glucopyranose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,3,4,6-TETRA-O-ACETYL-2-AZIDO-2-DEOXY-α-D-GLUCOPYRANOSE
CAS:Formula:C14H19N3O9Purity:98%Color and Shape:SolidMolecular weight:373.31541,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-α-D-glucopyranose (min. 97% α-anomer)
CAS:1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-α-D-glucopyranose (min. 97% α-anomer)Color and Shape:SolidMolecular weight:373.32g/mol1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-a-D-glucopyranose
CAS:Formula:C14H19N3O9Molecular weight:373.321,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-a-D-glucopyranose
CAS:<p>1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-a-D-glucopyranose is a fluorinated monosaccharide with a synthetic sequence. It is used to synthesize oligosaccharides and polysaccharides by glycosylation or by click modification. It can be methylated and acetylated for further modification. 1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxyglucopyranose has CAS number 56883–33–1 and is of high purity.</p>Formula:C14H19N3O9Purity:Min. 95%Color and Shape:SolidMolecular weight:373.32 g/mol




