CAS 56889-55-5
:[(3S,4S,5S,6R)-3,4,6-triacetoxy-5-[(3S,4S,5R,6S)-3,4,5-tribenzyloxy-6-methyl-tetrahydropyran-2-yl]oxy-tetrahydropyran-2-yl]methyl acetate
Description:
The chemical substance with the name "[(3S,4S,5S,6R)-3,4,6-triacetoxy-5-[(3S,4S,5R,6S)-3,4,5-tribenzyloxy-6-methyl-tetrahydropyran-2-yl]oxy-tetrahydropyran-2-yl]methyl acetate" and CAS number 56889-55-5 is a complex organic compound characterized by multiple functional groups, including acetoxy and benzyloxy moieties. It features a tetrahydropyran backbone, which is a six-membered cyclic ether, contributing to its structural complexity and potential biological activity. The presence of multiple acetoxy groups suggests that the compound may exhibit reactivity typical of esters, while the benzyloxy groups could enhance its lipophilicity and influence its solubility in organic solvents. The stereochemistry indicated by the (S) and (R) designations suggests specific spatial arrangements of atoms, which can significantly affect the compound's properties and interactions. Such compounds are often of interest in medicinal chemistry and natural product synthesis due to their potential therapeutic applications. Overall, this substance exemplifies the intricate nature of organic molecules and their diverse functionalities.
Formula:C41H48O14
InChI:InChI=1/C41H48O14/c1-25-34(47-21-30-15-9-6-10-16-30)36(48-22-31-17-11-7-12-18-31)38(49-23-32-19-13-8-14-20-32)40(50-25)55-39-37(52-28(4)44)35(51-27(3)43)33(24-46-26(2)42)54-41(39)53-29(5)45/h6-20,25,33-41H,21-24H2,1-5H3/t25-,33?,34+,35-,36-,37-,38-,39-,40?,41-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1,3,4,6-Tetra-O-acetyl-2-(2,3,4-tri-O-benzyl-a-L-fucopyranosyl)-a-D-galactopyranose
CAS:1,3,4,6-Tetra-O-acetyl-2-(2,3,4-tri-O-benzyl-a-L-fucopyranosyl)-a-D-galactopyranose is a methylated saccharide that has been synthesized to be used in the synthesis of complex carbohydrates. It is also called Tetra O Acetyl D Galactopyranoside. The chemical name of this product is 1,3,4,6 Tetra O Acetyl 2-(2,3,4 Tri O Benzyl A L Fucopyranosyl) A D Galactopyranose Methyl Ester. This product is also known as 6Fluoro 3 Indoxyl Beta D Galactopyranoside. This product can be custom synthesized to order and it can be modified based on customer specifications.Formula:C41H48O14Purity:Min. 95%Molecular weight:764.81 g/mol

