CAS 5689-33-8

3-(CYANOMETHYL)BENZOIC ACID

Description:

3-(Cyanomethyl)benzoic acid, with the CAS number 5689-33-8, is an organic compound characterized by the presence of both a benzoic acid moiety and a cyanomethyl group. This compound features a benzene ring substituted at the meta position with a cyanomethyl group (-CH2-CN) and a carboxylic acid group (-COOH). The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The cyanomethyl group contributes to the compound's reactivity, making it useful in synthetic organic chemistry, particularly in the formation of other derivatives. 3-(Cyanomethyl)benzoic acid is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. Its unique structure allows for potential applications in pharmaceuticals, agrochemicals, and materials science, where it can serve as an intermediate or building block for more complex molecules.

Formula: C₉H₇NO₂

InChI: InChI=1/C9H7NO2/c10-5-4-7-2-1-3-8(6-7)9(11)12/h1-3,6H,4H2,(H,11,12)

SMILES: c1cc(CC#N)cc(c1)C(=O)O

Synonyms:

• Benzoic Acid, 3-(Cyanomethyl)-

3-Carboxyphenylacetonitrile (3-(Cyanomethyl)benzoic acid)

CAS: 5689-33-8

Nitrile function compounds, nesoi

Formula: C₉H₇NO₂

Color and Shape: White Solid

Molecular weight: 161.04768

Ref: 45-1A02760

3-(Cyanomethyl)benzoic acid

CAS: 5689-33-8

Formula: C₉H₇NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 161.1574

Ref: IN-DA0037MA

3-(Cyanomethyl)benzoic acid

CAS: 5689-33-8

3-(Cyanomethyl)benzoic acid

Purity: 97%

Molecular weight: 161.16g/mol

Ref: 54-OR965652

Ketoprofen EP Impurity H

CAS: 5689-33-8

Formula: C₉H₇NO₂

Color and Shape: White To Off-White Solid

Molecular weight: 161.16

Ref: 4Z-K-0215

3-(Cyanomethyl)benzoic Acid

CAS: 5689-33-8

Color and Shape: Neat

Ref: 86-MM0001.22

Ketoprofen EP impurity H

CAS: 5689-33-8

Formula: C₉H₇NO₂

Molecular weight: 161.16

Ref: ST-EA-CP-K3008

3-(Cyanomethyl)benzoic acid

CAS: 5689-33-8

3-(Cyanomethyl)benzoic acid is a useful building block that is used as a reagent in the production of pharmaceuticals and research chemicals. It is also used as a speciality chemical and as a high-quality fine chemical. This compound has versatile uses, including reactions with other chemicals to form complex compounds, and can be used as a reaction component or an intermediate in the synthesis of other chemicals. 3-(Cyanomethyl)benzoic acid has no known toxicity and its CAS number is 5689-33-8.

Formula: C₉H₇NO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 161.16 g/mol

Ref: 3D-FC67887

3-(Cyanomethyl)benzoic acid

CAS: 5689-33-8

Formula: C₉H₇NO₂

Purity: 95%

Molecular weight: 161.16

Ref: 10-F077968

3-(Cyanomethyl)benzoic Acid

Controlled Product

CAS: 5689-33-8

Impurity Ketoprofen EP Impurity H
Applications 3-(Cyanomethyl)benzoic Acid (Ketoprofen EP Impurity H) is a reagent used in the synthesis of various pharmaceutically important compounds, such as its use in the synthesis of neprilysin inhibitors.
References Solomon, S.D., et al.: Lancet., 380 1387 (2012); Dadd, M.R., et al.: Enzyme. Microb. Tehcnol., 29, 20 (2001);

Formula: C₉H₇NO₂

Color and Shape: Neat

Molecular weight: 161.16

Ref: TR-C981890