CAS 56893-25-5

methyl 4-(bromoacetyl)benzoate

Description:

Methyl 4-(bromoacetyl)benzoate is an organic compound characterized by its ester functional group and the presence of a bromine atom. It features a benzoate structure, where a methyl group is esterified to a benzoic acid derivative, specifically at the para position relative to the acetyl group. The bromoacetyl moiety introduces both electrophilic and nucleophilic reactivity, making this compound useful in various synthetic applications, particularly in the field of medicinal chemistry and organic synthesis. The presence of the bromine atom enhances its reactivity, allowing for further functionalization. Methyl 4-(bromoacetyl)benzoate is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, such as dichloromethane and ethyl acetate, but has limited solubility in water. Safety precautions should be taken when handling this compound, as it may pose health risks due to its bromine content and potential reactivity. Proper storage and disposal methods are essential to mitigate any environmental impact.

Formula: C₁₀H₉BrO₃

InChI: InChI=1/C10H9BrO3/c1-14-10(13)8-4-2-7(3-5-8)9(12)6-11/h2-5H,6H2,1H3

SMILES: COC(=O)c1ccc(cc1)C(=O)CBr

Synonyms:

• Benzoic Acid, 4-(2-Bromoacetyl)-, Methyl Ester
• 4-(2-Bromoacetyl)benzoic Acid Methyl Ester
• Methyl 4-(bromoacetyl)benzoate

Methyl 4-(2-Bromoacetyl)Benzoate

CAS: 56893-25-5

Formula: C₁₀H₉BrO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 257.0807

Ref: IN-DA0037MB

Methyl 4-(bromoacetyl)benzoate

CAS: 56893-25-5

Methyl 4-(bromoacetyl)benzoate

Formula: C₁₀H₉BrO₃

Purity: 97%

Color and Shape: beige solid

Molecular weight: 257.08g/mol

Ref: 54-OR46535

Methyl 4-(2-bromoacetyl)benzoate

CAS: 56893-25-5

Formula: C₁₀H₉BrO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 257.083

Ref: 10-F240420