CAS 56899-56-0
:Hydrazoic acid, compd. with N,N,N′,N′-tetramethylguanidine (1:1)
Description:
Hydrazoic acid, when combined with N,N,N′,N′-tetramethylguanidine in a 1:1 ratio, forms a complex that exhibits unique chemical characteristics. Hydrazoic acid (HN3) is a highly energetic and unstable compound known for its explosive properties, particularly when concentrated. It is a colorless, volatile liquid with a faint, unpleasant odor. The presence of N,N,N′,N′-tetramethylguanidine, a strong organic base, can stabilize the hydrazoic acid in this compound, potentially altering its reactivity and solubility. This combination may exhibit enhanced solubility in organic solvents and could be used in various chemical synthesis applications. The interaction between the acidic and basic components can lead to interesting acid-base chemistry, influencing the overall stability and reactivity of the compound. However, due to the hazardous nature of hydrazoic acid, handling and storage require strict safety precautions to prevent accidental detonation or exposure. Overall, this compound represents a fascinating area of study in the field of coordination chemistry and energetic materials.
Formula:C5H13N3·HN3
InChI:InChI=1S/C5H13N3.HN3/c1-7(2)5(6)8(3)4;1-3-2/h6H,1-4H3;1H
InChI key:InChIKey=QRNVKPVRQAMLDU-UHFFFAOYSA-N
SMILES:[N+](=[N-])=N.C(N(C)C)(N(C)C)=N
Synonyms:- (E)-(dimethylamino)(imino)-N-methyl-N-methylidenemethanaminium azide
- Guanidine, N,N,N′,N′-tetramethyl-, monohydrazoate
- Guanidine, tetramethyl-, hydrazoate
- Hydrazoic acid, compd. with N,N,N′,N′-tetramethylguanidine (1:1)
- N-[amino(dimethylamino)methylidene]-N-methylmethanaminium azide
- Tetramethylguanidinium azide
- 1,1,3,3-Tetramethylguanidinium azide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N,N,N’,N’-tetramethylguanidine azide
CAS:Formula:C5H14N6Color and Shape:SolidMolecular weight:158.209
