CAS 569-15-3
:1,4-Phenanthrenequinone
Description:
1,4-Phenanthrenequinone, with the CAS number 569-15-3, is a polycyclic aromatic compound characterized by its distinctive quinone structure, which features two carbonyl groups (C=O) at the 1 and 4 positions of the phenanthrene framework. This compound typically appears as a yellow to orange solid and is known for its strong absorbance in the ultraviolet-visible spectrum due to its conjugated system. It is relatively stable under standard conditions but can undergo reduction to form phenanthrene or other derivatives. 1,4-Phenanthrenequinone is utilized in various applications, including organic synthesis and as a reagent in chemical research. Its reactivity is attributed to the electrophilic nature of the carbonyl groups, allowing it to participate in nucleophilic addition reactions. Additionally, it exhibits biological activity, which has been the subject of research in the context of its potential effects on cellular processes. Proper handling and storage are essential due to its potential toxicity and reactivity with various nucleophiles.
Formula:C14H8O2
InChI:InChI=1S/C14H8O2/c15-12-7-8-13(16)14-10-4-2-1-3-9(10)5-6-11(12)14/h1-8H
InChI key:InChIKey=POZPGRADIOPGIR-UHFFFAOYSA-N
SMILES:O=C1C=2C=3C(C=CC2C(=O)C=C1)=CC=CC3
Synonyms:- 1,4-Dihydrophenanthrene-1,4-dione
- 1,4-Phenanthraquinone
- 1,4-Phenanthrenedione
- 1,4-Phenanthrenequinone
- 1,4-Phenanthroquinone
- 5,8-Phenanthraquinone
- NSC 148970
- phenanthrene-1,4-quinone
- PHENANTHRENE-1,4-DIONE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
