CAS 569-42-6
:1,8-Dihydroxynaphthalene
Description:
1,8-Dihydroxynaphthalene, with the CAS number 569-42-6, is an organic compound characterized by the presence of two hydroxyl (-OH) groups attached to the naphthalene structure at the 1 and 8 positions. This compound appears as a white to light yellow crystalline solid and is soluble in alcohol and ether, but less soluble in water. It exhibits properties typical of phenolic compounds, including the ability to form hydrogen bonds, which can influence its reactivity and interactions with other substances. 1,8-Dihydroxynaphthalene is known for its role in various chemical reactions, including oxidation and complexation with metal ions, making it useful in analytical chemistry and as a precursor in organic synthesis. Additionally, it has applications in the production of dyes and pigments due to its chromophoric properties. The compound's structure allows for potential applications in materials science and pharmaceuticals, where its reactivity can be harnessed for the development of new materials or therapeutic agents.
Formula:C10H8O2
InChI:InChI=1S/C10H8O2/c11-8-5-1-3-7-4-2-6-9(12)10(7)8/h1-6,11-12H
InChI key:InChIKey=OENHRRVNRZBNNS-UHFFFAOYSA-N
SMILES:OC=1C2=C(C=CC=C2O)C=CC1
Synonyms:- 1,8-Dihydroxynaphthalene
- 1,8-Naphthalenediol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,8-Naphthalenediol
CAS:Formula:C10H8O2Purity:≥ 97.0%Color and Shape:White to beige or light-brown powder or crystalsMolecular weight:160.201,8-Naphthalenediol
CAS:1,8-NaphthalenediolFormula:C10H8O2Purity:97%Color and Shape: dark brown powderMolecular weight:160.17g/molNaphthalene-1,8-diol
CAS:Formula:C10H8O2Purity:95%Color and Shape:Solid, Almost whiteMolecular weight:160.172Naphthalene-1,8-diol
CAS:<p>Naphthalene-1,8-diol is a compound that belongs to the class of polycyclic aromatic hydrocarbons. It has been shown to inhibit polymerase chain reactions (PCR) in a nuclear DNA template. Naphthalene-1,8-diol also inhibits the production of melanin and reduces the number of skin lesions in the wild-type strain of Galleria mellonella. Naphthalene-1,8-diol is an antioxidant compound that has been shown to protect against radiation and dermatitis. This molecule contains a hydroxyl group that can form hydrogen bonds with other molecules. This property may account for its anti-inflammatory effects.</p>Formula:C10H8O2Purity:Min. 95%Color and Shape:Slightly Brown PowderMolecular weight:160.17 g/mol





