CAS 569-77-7
:Purpurogallin
Description:
Purpurogallin, with the CAS number 569-77-7, is a chemical compound that belongs to the class of polyphenols. It is derived from the oxidation of gallic acid and is known for its distinctive purple color, which is a result of its complex molecular structure. Purpurogallin exhibits antioxidant properties, making it of interest in various biochemical applications, particularly in studies related to oxidative stress and cellular protection. The compound is soluble in water and organic solvents, which enhances its utility in laboratory settings. Additionally, purpurogallin can form complexes with metal ions, which may have implications in both analytical chemistry and potential therapeutic applications. Its structure includes multiple hydroxyl groups, contributing to its reactivity and interaction with other molecules. Overall, purpurogallin serves as a valuable compound in research, particularly in the fields of biochemistry and pharmacology, due to its unique properties and potential health benefits.
Formula:C11H8O5
InChI:InChI=1S/C11H8O5/c12-6-3-1-2-5-4-7(13)10(15)11(16)8(5)9(6)14/h1-4,13,15-16H,(H,12,14)
InChI key:InChIKey=WDGFFVCWBZVLCE-UHFFFAOYSA-N
SMILES:OC1=C2C(=CC(O)=C1O)C=CC=C(O)C2=O
Synonyms:- NSC 646653
- 2,3,4,6-Tetrahydroxy-5H-benzocyclohepten-5-one
- NSC 35676
- Purpurogallin
- 5H-Benzocyclohepten-5-one, 2,3,4,6-tetrahydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Purpurogallin
CAS:Purpurogallin: natural phenol from Quercus spp., xanthine oxidase inhibitor (IC50: 0.2μM), antioxidant, anti-inflammatory.Formula:C11H8O5Purity:96.44%Color and Shape:SolidMolecular weight:220.18Purpurogallin
CAS:Purpurogallin is a natural compound that has been shown to inhibit the growth of human pathogens. It is synthesized by plants and found in many medicinal herbs and plant extracts. Purpurogallin inhibits the replication of viruses, such as herpes simplex virus, influenza A virus, and hepatitis C virus. Purpurogallin has also been shown to inhibit epidermal growth factor-induced proliferation of human Hl-60 cells and light signal transmission. Purpurogallin is a glycol ether with gsh-px activities that are involved in protein synthesis. X-ray crystallography studies have shown that purpurogallin coordinates with the active site of human GSH-px enzyme.Formula:C11H8O5Purity:Min. 95%Color and Shape:PowderMolecular weight:220.18 g/mol2,3,4,6-tetrahydroxy-5H-benzo[7]annulen-5-one
CAS:Formula:C11H8O5Purity:95.0%Color and Shape:Yellow to deep yellow red powderMolecular weight:220.182,3,4,6-Tetrahydroxy-5H-benzo[7]annulen-5-one
CAS:Controlled Product<p>Stability Air Sensitive<br>Applications 2,3,4,6-tetrahydroxy-5H-benzo[7]annulen-5-one (cas# 569-77-7) is a useful research chemical.<br></p>Formula:C11H8O5Color and Shape:NeatMolecular weight:220.18




