CAS 5691-02-1

2-[(pyridin-2-ylmethyl)amino]benzoic acid

Description:

2-[(Pyridin-2-ylmethyl)amino]benzoic acid, also known by its CAS number 5691-02-1, is an organic compound characterized by its dual functional groups: an amino group and a carboxylic acid group, which contribute to its properties as an acid. This compound features a benzoic acid moiety substituted with a pyridin-2-ylmethyl amino group, providing it with both aromatic and heterocyclic characteristics. The presence of the pyridine ring enhances its potential for hydrogen bonding and coordination with metal ions, making it of interest in coordination chemistry and medicinal applications. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to its functional groups. The compound's structure allows for various interactions, including potential biological activity, which can be explored in pharmaceutical research. Additionally, its properties can be influenced by pH, temperature, and solvent conditions, making it a versatile compound in both synthetic and analytical chemistry contexts.

Formula: C₁₃H₁₂N₂O₂

InChI: InChI=1/C13H12N2O2/c16-13(17)11-6-1-2-7-12(11)15-9-10-5-3-4-8-14-10/h1-8,15H,9H2,(H,16,17)

SMILES: c1ccc(c(c1)C(=O)O)NCc1ccccn1

Synonyms:

• Benzoic Acid, 2-[(2-Pyridinylmethyl)Amino]-

2-[(2-pyridinylmethyl)amino]benzoic acid

CAS: 5691-02-1

Formula: C₁₃H₁₂N₂O₂

Purity: 95.0%

Molecular weight: 228.251

Ref: 10-F315680