CAS 5691-20-3

(1R,2S)-2-aminocyclohexanecarboxylic acid

Description:

(1R,2S)-2-aminocyclohexanecarboxylic acid, commonly known as L-2-aminocyclohexanecarboxylic acid, is an amino acid characterized by its cyclohexane ring structure with an amino group and a carboxylic acid functional group. This compound is a chiral molecule, possessing two stereocenters, which contributes to its specific optical activity. It is typically found in its L-form, which is biologically relevant and can be involved in various biochemical processes. The presence of the amino and carboxylic acid groups allows it to participate in peptide bond formation, making it significant in protein synthesis. Additionally, its cyclohexane ring provides a unique steric environment that can influence its interactions with enzymes and receptors. This compound is soluble in water and exhibits typical amino acid behavior, such as zwitterionic properties at physiological pH. Its applications may extend to pharmaceuticals, where it can serve as a building block for drug synthesis or as a potential therapeutic agent due to its structural characteristics.

Formula: C₇H₁₃NO₂

InChI: InChI=1/C7H13NO2/c8-6-4-2-1-3-5(6)7(9)10/h5-6H,1-4,8H2,(H,9,10)/t5-,6+/m1/s1

Cyclohexanecarboxylic acid, 2-amino-, (1R,2S)-rel-

CAS: 5691-20-3

Formula: C₇H₁₃NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 143.1836

Ref: IN-DA00EAX4

cis-2-Aminocyclohexanecarboxylic acid

CAS: 5691-20-3

Ref: 7W-GM2978

cis-2-Amino-1-cyclohexanecarboxylic acid

CAS: 5691-20-3

cis-2-Amino-1-cyclohexanecarboxylic acid

Purity: ≥95%

Molecular weight: 143.18g/mol

Ref: 54-OR308193

cis-2-Amino-1-cyclohexane-carboxylic acid

CAS: 5691-20-3

Cis-2-Amino-1-cyclohexane-carboxylic acid (ACCA) is a β-amino acid that binds to peptides and cyclohexane rings. ACCA has been shown to have high resistance against denaturation, which may be due to its ability to form hydrogen bonds with water molecules. It also has an analog, cis-2-(aminomethyl)cyclohexanol (CAMCH), which is used in the treatment of Gram-positive bacterial infections. ACCA can be found in glycopeptide antibiotics such as vancomycin and teicoplanin, which are used for the treatment of resistant bacteria including methicillin resistant Staphylococcus aureus (MRSA).

Formula: C₇H₁₃NO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 143.18 g/mol

Ref: 3D-FA43689