CAS 56911-50-3
:3-Hydroxy-α-methylbenzeneacetic acid
Description:
3-Hydroxy-α-methylbenzeneacetic acid, also known by its CAS number 56911-50-3, is an organic compound characterized by its aromatic structure and functional groups. It features a hydroxyl group (-OH) and a carboxylic acid group (-COOH) attached to a benzene ring, which contributes to its acidic properties. The presence of the α-methyl group enhances its hydrophobic characteristics while also influencing its reactivity and solubility in various solvents. This compound is typically a white to off-white solid at room temperature and is soluble in polar solvents due to the hydroxyl and carboxylic acid functionalities. It may exhibit biological activity, making it of interest in pharmaceutical and biochemical research. The compound's structure allows for potential interactions with biological systems, which could lead to various applications in medicinal chemistry. As with many organic acids, it may participate in acid-base reactions and can serve as a precursor for the synthesis of more complex molecules. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C9H10O3
InChI:InChI=1S/C9H10O3/c1-6(9(11)12)7-3-2-4-8(10)5-7/h2-6,10H,1H3,(H,11,12)
InChI key:InChIKey=BYRVXROVZBYNOZ-UHFFFAOYSA-N
SMILES:C(C(O)=O)(C)C1=CC(O)=CC=C1
Synonyms:- (±)-2-(3-Hydroxyphenyl)propionic acid
- 3-Hydroxy-α-methylbenzeneacetic acid
- 2-(3-Hydroxyphenyl)propanoic acid
- Benzeneacetic acid, 3-hydroxy-α-methyl-
- Hydratropic acid, m-hydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-(3-Hydroxyphenyl)propionic acid, (+/-)-
CAS:2-(3-Hydroxyphenyl)propionic acid, (+/-)- is a bioactive chemical.Formula:C9H10O3Color and Shape:SolidMolecular weight:166.172-(3-hydroxyphenyl)propanoic acid
CAS:Controlled ProductFormula:C9H10O3Color and Shape:NeatMolecular weight:166.1742-(3-Hydroxyphenyl)propanoic acid
CAS:2-(3-Hydroxyphenyl)propanoic acid (HPPA) is a phenolic compound that is synthesized by colonic microflora from the hydrolysis of dietary polyphenols, such as 4-hydroxycinnamic acid. HPPA has been shown to have immunomodulatory effects, which may be due to its ability to reduce proinflammatory cytokines, and it may be useful in the treatment of inflammatory bowel disease. HPPA also inhibits microbial metabolism through the inhibition of dehydrogenase deficiency, which is a potential mechanism for its anti-bacterial effects. HPPA has low bioavailability due to its poor solubility and low absorption rate through the gut wall.Formula:C9H10O3Purity:Min. 95%Molecular weight:166.17 g/mol


