CAS 56916-85-9

N-(4-methoxybenzyl)tricyclo[3.3.1.1~3,7~]decan-1-amine

Description:

N-(4-methoxybenzyl)tricyclo[3.3.1.1^3,7]decan-1-amine, with the CAS number 56916-85-9, is a chemical compound characterized by its unique tricyclic structure, which consists of three interconnected cycloalkane rings. This compound features an amine functional group, which contributes to its potential as a ligand in various chemical reactions. The presence of the 4-methoxybenzyl group enhances its lipophilicity, potentially influencing its solubility and biological activity. The tricyclic framework provides rigidity, which can affect the compound's conformational properties and interactions with biological targets. Additionally, the methoxy group may participate in hydrogen bonding and influence the compound's reactivity. Overall, this compound's structural characteristics suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or as a building block in organic synthesis. However, specific properties such as melting point, boiling point, and reactivity would require empirical data for a comprehensive understanding.

Formula: C₁₈H₂₅NO

InChI: InChI=1/C18H25NO/c1-20-17-4-2-13(3-5-17)12-19-18-9-14-6-15(10-18)8-16(7-14)11-18/h2-5,14-16,19H,6-12H2,1H3

SMILES: COc1ccc(cc1)CNC12CC3CC(CC(C3)C2)C1

Synonyms:

• N-(4-Methoxybenzyl)adamantan-1-amine
• Tricyclo[3.3.1.1~3,7~]decan-1-amine, N-[(4-methoxyphenyl)methyl]-

N-(4-methoxybenzyl)-1-adamantanamine hydrobromide

CAS: 56916-85-9

Purity: 95.0%

Molecular weight: 352.3160095214844

Ref: 10-F361363