CAS 5692-29-5

N-(5-Aminopentyl)benzamide

Description:

N-(5-Aminopentyl)benzamide, with the CAS number 5692-29-5, is an organic compound characterized by its amide functional group and a benzene ring. This compound features a pentyl chain with an amino group attached to the nitrogen, which contributes to its basicity and potential reactivity. The presence of the benzamide structure indicates that it may exhibit properties typical of amides, such as moderate solubility in polar solvents and the ability to participate in hydrogen bonding. The amino group can also engage in various chemical reactions, including acylation and alkylation, making it a versatile intermediate in organic synthesis. Additionally, the compound may display biological activity, which could be of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of compounds targeting specific biological pathways. Overall, N-(5-Aminopentyl)benzamide is a compound of interest due to its unique structural features and potential utility in various chemical and biological contexts.

Formula: C₁₂H₁₈N₂O

InChI: InChI=1S/C12H18N2O/c13-9-5-2-6-10-14-12(15)11-7-3-1-4-8-11/h1,3-4,7-8H,2,5-6,9-10,13H2,(H,14,15)

InChI key: InChIKey=GCFYRWMWMMXAQR-UHFFFAOYSA-N

SMILES: C(NCCCCCN)(=O)C1=CC=CC=C1

Synonyms:

• N-Benzoylcadaverine
• Benzamide, N-(5-aminopentyl)-
• Monobenzoylcadaverine
• N-(5-Aminopentyl)benzamide

N-(5-aminopentyl)benzamide

Controlled Product

CAS: 5692-29-5

Formula: C₁₂H₁₈N₂O

Color and Shape: Neat

Molecular weight: 206.284

Ref: TR-B406355