CAS 56921-01-8
:2-Thiophenecarboxylic acid, 5-methyl-4-nitro-, methyl ester
Description:
2-Thiophenecarboxylic acid, 5-methyl-4-nitro-, methyl ester, with the CAS number 56921-01-8, is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. This compound features a carboxylic acid functional group that has been esterified with methanol, resulting in a methyl ester. The presence of a methyl group at the 5-position and a nitro group at the 4-position of the thiophene ring contributes to its unique chemical properties and reactivity. Typically, compounds of this nature exhibit moderate polarity due to the presence of both the ester and nitro functional groups, which can influence their solubility in various solvents. Additionally, the nitro group can enhance the compound's electrophilic character, making it a potential candidate for further chemical reactions, such as nucleophilic substitutions or reductions. Overall, this compound may find applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of more complex chemical entities.
Formula:C7H7NO4S
InChI:InChI=1/C7H7NO4S/c1-4-5(8(10)11)3-6(13-4)7(9)12-2/h3H,1-2H3
InChI key:InChIKey=QXIFGUCZQLEFBZ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(N(=O)=O)=C(C)S1
Synonyms:- 2-Thiophenecarboxylic acid, 5-methyl-4-nitro-, methyl ester
- 5-Methyl-4-nitrothiophene-2-carboxylic acid methyl ester
- Methyl 2-methyl-3-nitrothiophene-5-carboxylate
- Methyl 5-methyl-4-nitrothiophene-2-carboxylate
- NSC 108993
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Thiophenecarboxylic acid, 5-methyl-4-nitro-, methyl ester
CAS:Formula:C7H7NO4SPurity:96%Color and Shape:SolidMolecular weight:201.1998Methyl 5-methyl-4-nitrothiophene-2-carboxylate
CAS:Methyl 5-methyl-4-nitrothiophene-2-carboxylatePurity:96%Molecular weight:201.20g/molMethyl 5-methyl-4-nitrothiophene-2-carboxylate
CAS:Methyl 5-methyl-4-nitrothiophene-2-carboxylate (MMTC) is a potent and selective inhibitor of the RNA polymerase. MMTC inhibits the replication of both single stranded and double stranded RNA viruses, such as hepatitis C virus (HCV), human immunodeficiency virus (HIV), and influenza. MMTC is an allosteric inhibitor that binds to the active site of the polymerase at a specific site, which prevents it from binding to its natural substrate, rRNA. This binding prevents elongation of the RNA chain by interfering with nucleotide addition, leading to termination of RNA synthesis. MMTC also inhibits replication of subgenomic RNAs in HCV and HIV infection.
Formula:C7H7NO4SPurity:Min. 95%Molecular weight:201.2 g/mol



