CAS 56921-85-8

2-(4-Bromophenyl)imidazo[1,2-a]pyrimidine

Description:

2-(4-Bromophenyl)imidazo[1,2-a]pyrimidine is a heterocyclic compound characterized by its imidazo and pyrimidine rings, which contribute to its biological activity and potential applications in medicinal chemistry. The presence of the 4-bromophenyl group enhances its lipophilicity and may influence its interaction with biological targets. This compound typically exhibits a solid-state form at room temperature and is soluble in organic solvents, making it suitable for various synthetic and analytical applications. Its structure suggests potential for diverse reactivity, including electrophilic substitution and nucleophilic attack, which can be exploited in further chemical modifications. Additionally, compounds of this class have been studied for their pharmacological properties, including anti-cancer and anti-inflammatory activities. The specific characteristics, such as melting point, boiling point, and spectral data, would depend on the purity and specific conditions under which the compound is analyzed. Overall, 2-(4-Bromophenyl)imidazo[1,2-a]pyrimidine represents a valuable scaffold in drug discovery and development.

Formula: C₁₂H₈BrN₃

InChI: InChI=1S/C12H8BrN3/c13-10-4-2-9(3-5-10)11-8-16-7-1-6-14-12(16)15-11/h1-8H

SMILES: c1cnc2nc(cn2c1)c1ccc(cc1)Br

Synonyms:

• 2-(4-Bromo-Phenyl)-Imidazo[1,2-A]Pyrimidine

2-(4-BROMO-PHENYL)-IMIDAZO[1,2-A]PYRIMIDINE

CAS: 56921-85-8

Formula: C₁₂H₈BrN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 274.1160

Ref: IN-DA00E9SW

2-(4-Bromophenyl)imidazo[1,2-a]pyrimidine

CAS: 56921-85-8

Purity: 98%

Molecular weight: 274.1210021972656

Ref: 10-F629905