CAS 56926-53-5
:(2S,5S)-5-fluoro-6-(hydroxymethyl)-2-methoxy-tetrahydropyran-3,4-diol
Description:
The chemical substance known as (2S,5S)-5-fluoro-6-(hydroxymethyl)-2-methoxy-tetrahydropyran-3,4-diol, with the CAS number 56926-53-5, is a fluorinated sugar derivative. It features a tetrahydropyran ring, which is a six-membered cyclic ether, and contains multiple functional groups, including a hydroxymethyl group and a methoxy group. The presence of the fluorine atom introduces unique reactivity and potential biological activity, making it of interest in medicinal chemistry. This compound is characterized by its stereochemistry, indicated by the (2S,5S) configuration, which plays a crucial role in its interaction with biological systems. The hydroxymethyl and methoxy groups contribute to its solubility and reactivity, while the tetrahydropyran structure provides a stable framework. Such compounds are often studied for their potential applications in pharmaceuticals, particularly in the development of antiviral or antidiabetic agents. Overall, this substance exemplifies the complexity and diversity of organic molecules in medicinal chemistry.
Formula:C7H13FO5
InChI:InChI=1/C7H13FO5/c1-12-7-6(11)5(10)4(8)3(2-9)13-7/h3-7,9-11H,2H2,1H3/t3?,4-,5?,6?,7+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 4-deoxy-4-fluoro-a-D-glucose
CAS:Methyl 4-deoxy-4-fluoro-a-D-glucose is a synthetic and custom synthesis monosaccharide for use in glycosylation, polysaccharide modification, and click chemistry. It is a fluorinated sugar that can be used in the synthesis of oligosaccharides and complex carbohydrates. Methyl 4-deoxy-4-fluoro-a-D-glucose has CAS number 56926-53-5.Formula:C7H13FO5Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:196.17 g/molMethyl 4-Deoxy-4-fluoro-alpha-D-glucose
CAS:Controlled ProductApplications Methyl 4-Deoxy-4-fluoro-α-D-glucose (cas# 56926-53-5) is a compound useful in organic synthesis.
Formula:C7H13FO5Color and Shape:NeatMolecular weight:196.17



