CAS 56926-94-4
:Boc-Ser(Tos)-OMe
Description:
Boc-Ser(Tos)-OMe, also known as Boc-protected serine with a tosyl (Tos) group and a methoxy (OMe) ester, is a chemical compound commonly used in peptide synthesis and organic chemistry. The "Boc" (tert-butyloxycarbonyl) group serves as a protective group for the amino function of serine, allowing for selective reactions without interfering with the amino group. The tosyl group, derived from p-toluenesulfonic acid, enhances the electrophilicity of the hydroxyl group, facilitating further chemical transformations. The methoxy group provides a methyl ester functionality, which can be hydrolyzed to yield the corresponding carboxylic acid. This compound is typically a white to off-white solid and is soluble in organic solvents such as dichloromethane and methanol. Its stability under various reaction conditions makes it a valuable intermediate in the synthesis of more complex molecules, particularly in the field of medicinal chemistry and peptide development. Proper handling and storage are essential, as with many chemical substances, to ensure safety and maintain compound integrity.
Formula:C16H23NO7S
InChI:InChI=1/C16H23NO7S/c1-11-6-8-12(9-7-11)25(20,21)23-10-13(14(18)22-5)17-15(19)24-16(2,3)4/h6-9,13H,10H2,1-5H3,(H,17,19)/t13-/m0/s1
SMILES:Cc1ccc(cc1)S(=O)(=O)OC[C@@H](C(=O)OC)N=C(O)OC(C)(C)C
Synonyms:- L-Serine, N-[(1,1-dimethylethoxy)carbonyl]-O-[(4-methylphenyl)sulfonyl]-, methyl ester
- Methyl N-(tert-butoxycarbonyl)-O-[(4-methylphenyl)sulfonyl]-L-serinate
- Boc-Ser(Tos)-Och3
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(S)-Methyl 2-((Tert-Butoxycarbonyl)Amino)-3-(Tosyloxy)Propanoate
CAS:(S)-Methyl 2-((Tert-Butoxycarbonyl)Amino)-3-(Tosyloxy)PropanoatePurity:98%Molecular weight:373.42g/molBoc-Ser(Tos)-OMe
CAS:Boc-Ser(Tos)-OMe is a c6 alkyl, electrophilic and methyl ester. It has been used as an intermediate in the synthesis of drugs such as cefuroxime and tetracycline. This compound is also used to produce organic fluorine compounds that are important in the manufacture of plastics, insecticides, perfumes and pharmaceuticals. Boc-Ser(Tos)-OMe is an inorganic compound with a fluoro group, which is an important component for the production of polymers. The chloro group also plays an important role in this process by introducing chlorine into the polymer chain. The ammonium group can be replaced by other functional groups like alkoxy or alkyl groups to produce different derivatives. Boc-Ser(Tos)-OMe undergoes oxidative reactions when exposed to air or light to form a carboxylic acid derivative, which can be removed by treatment with acids.Formula:C16H23NO7SPurity:Min. 95%Color and Shape:PowderMolecular weight:373.42 g/molBoc-L-Ser(Tos)-OCH3
CAS:M03324 - Boc-L-Ser(Tos)-OCH3
Formula:C16H23NO7SPurity:95%Color and Shape:Solid, White powderMolecular weight:373.42




