CAS 5693-42-5

(R)-phenyl(thiophen-2-yl)methanaminium

Description:

(R)-phenyl(thiophen-2-yl)methanaminium, with the CAS number 5693-42-5, is an organic compound characterized by its chiral center, which contributes to its enantiomeric properties. This substance features a phenyl group and a thiophene ring, indicating its potential for aromatic interactions and electronic delocalization. The presence of the ammonium group suggests that it can participate in hydrogen bonding, making it soluble in polar solvents. Its chiral nature may influence its biological activity, making it of interest in pharmaceutical applications. The compound's structure allows for various interactions, including π-π stacking due to the aromatic rings, which can affect its stability and reactivity. Additionally, the thiophene moiety may impart unique electronic properties, enhancing its potential use in organic electronics or as a ligand in coordination chemistry. Overall, (R)-phenyl(thiophen-2-yl)methanaminium presents a combination of structural features that could be exploited in various chemical and biological contexts.

Formula: C₁₁H₁₂NS

InChI: InChI=1/C11H11NS/c12-11(10-7-4-8-13-10)9-5-2-1-3-6-9/h1-8,11H,12H2/p+1/t11-/m1/s1

Phenyl(thiophen-2-yl)methanamine

CAS: 5693-42-5

Versatile small molecule scaffold

Formula: C₁₁H₁₁NS

Purity: Min. 95%

Molecular weight: 189.28 g/mol

Ref: 3D-FAA69342