CAS 569351-91-3: 7-(3-bromo-4-methoxybenzyl)-1-ethyl-8-[(2-hydroxycyclopentyl)amino]-3-(2-hydroxyethyl)-3,7-dihydro-1H-purine-2,6-dione
Description:The chemical substance known as "7-(3-bromo-4-methoxybenzyl)-1-ethyl-8-[(2-hydroxycyclopentyl)amino]-3-(2-hydroxyethyl)-3,7-dihydro-1H-purine-2,6-dione," with the CAS number 569351-91-3, is a complex organic compound that belongs to the purine class of molecules. It features multiple functional groups, including a brominated aromatic ring, methoxy group, and hydroxyethyl and hydroxycyclopentyl substituents, which contribute to its potential biological activity. The presence of the purine core suggests that it may interact with biological systems, possibly influencing nucleic acid metabolism or acting as a signaling molecule. Its structural complexity indicates potential for diverse pharmacological properties, making it a candidate for research in medicinal chemistry. The compound's solubility, stability, and reactivity would depend on its specific functional groups and overall molecular structure, which could influence its behavior in biological and chemical environments. Further studies would be necessary to elucidate its mechanism of action and therapeutic potential.
Formula:C22H28BrN5O5
InChI:InChI=1/C22H28BrN5O5/c1-3-26-20(31)18-19(27(9-10-29)22(26)32)25-21(24-15-5-4-6-16(15)30)28(18)12-13-7-8-17(33-2)14(23)11-13/h7-8,11,15-16,29-30H,3-6,9-10,12H2,1-2H3,(H,24,25)

7-(3-Bromo-4-methoxybenzyl)-1-ethyl-8-(((1R,2R)-2-hydroxycyclopentyl)amino)-3-(2-hydroxyethyl)-3,7-dihydro-1H-purine-2,6-dione
Controlled ProductRef: 3D-UXA35191
1g | 1,270.00 € | ||
50mg | 331.00 € | ||
100mg | 352.00 € | ||
250mg | 553.00 € | ||
500mg | 838.00 € |

Dasantafil
Ref: TM-T27122
2mg | 34.00 € |