CAS 569351-91-3
:7-(3-bromo-4-methoxybenzyl)-1-ethyl-8-[(2-hydroxycyclopentyl)amino]-3-(2-hydroxyethyl)-3,7-dihydro-1H-purine-2,6-dione
Description:
The chemical substance known as "7-(3-bromo-4-methoxybenzyl)-1-ethyl-8-[(2-hydroxycyclopentyl)amino]-3-(2-hydroxyethyl)-3,7-dihydro-1H-purine-2,6-dione," with the CAS number 569351-91-3, is a complex organic compound that belongs to the purine class of molecules. It features multiple functional groups, including a brominated aromatic ring, methoxy group, and hydroxyethyl and hydroxycyclopentyl substituents, which contribute to its potential biological activity. The presence of the purine core suggests that it may interact with biological systems, possibly influencing nucleic acid metabolism or acting as a signaling molecule. Its structural complexity indicates potential for diverse pharmacological properties, making it a candidate for research in medicinal chemistry. The compound's solubility, stability, and reactivity would depend on its specific functional groups and overall molecular structure, which could influence its behavior in biological and chemical environments. Further studies would be necessary to elucidate its mechanism of action and therapeutic potential.
Formula:C22H28BrN5O5
InChI:InChI=1/C22H28BrN5O5/c1-3-26-20(31)18-19(27(9-10-29)22(26)32)25-21(24-15-5-4-6-16(15)30)28(18)12-13-7-8-17(33-2)14(23)11-13/h7-8,11,15-16,29-30H,3-6,9-10,12H2,1-2H3,(H,24,25)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
7-(3-Bromo-4-methoxybenzyl)-1-ethyl-8-(((1R,2R)-2-hydroxycyclopentyl)amino)-3-(2-hydroxyethyl)-3,7-dihydro-1H-purine-2,6-dione
CAS:7-(3-Bromo-4-methoxybenzyl)-1-ethyl-8-(((1R,2R)-2-hydroxycyclopentyl)amino)-3-(2-hydroxyethyl)-3,7-dihydro-1H-purine-2,6-dionePurity:99%Molecular weight:522.4g/mol7-(3-Bromo-4-methoxybenzyl)-1-ethyl-8-(((1R,2R)-2-hydroxycyclopentyl)amino)-3-(2-hydroxyethyl)-3,7-dihydro-1H-purine-2,6-dione
CAS:Controlled ProductThe carbonic anhydrase inhibitor acetazolamide (Diamox) is a drug that inhibits the enzyme carbonic anhydrase. Acetazolamide is used for the treatment of glaucoma, epilepsy, and in some cases of altitude sickness. Inhibition of carbonic anhydrase leads to a build-up of bicarbonate ions and thus increased blood levels of CO2. This can lead to a number of symptoms including fatigue, nausea, vomiting, dizziness, headache, mental confusion, and kidney problems. Acetazolamide has been shown to be effective against prostate hyperplasia and may be able to alleviate certain symptoms associated with this condition. It may also be effective against angina pectoris caused by cardiac disease by inhibiting phosphodiesterases that break down cGMP in the heart.Formula:C22H28BrN5O5Purity:Min. 95%Molecular weight:522.4 g/molDasantafil
CAS:Dasantafil (SCH446132) is a small molecule phosphodiesterase-5A (PDE5A) inhibitor used to treat genitourinary disorders and study erectile dysfunction.Formula:C22H28BrN5O5Purity:99.4% - 99.50%Color and Shape:SolidMolecular weight:522.39



