CAS 5694-80-4

2,2-Diethyl-1,3-dioxolane-4-methanol

Description:

2,2-Diethyl-1,3-dioxolane-4-methanol, with the CAS number 5694-80-4, is an organic compound characterized by its dioxolane ring structure, which contributes to its unique chemical properties. This compound features two ethyl groups attached to the dioxolane ring, enhancing its hydrophobic characteristics, while the presence of a hydroxymethyl group (-CH2OH) introduces polarity and potential for hydrogen bonding. As a result, it may exhibit moderate solubility in polar solvents like water and higher solubility in organic solvents. The dioxolane moiety is known for its stability and can serve as a protective group in organic synthesis. Additionally, the compound may have applications in the synthesis of other organic molecules or as a solvent due to its relatively low toxicity compared to other solvents. Its physical properties, such as boiling point and density, would typically be influenced by the size and nature of the substituents on the dioxolane ring. Overall, 2,2-Diethyl-1,3-dioxolane-4-methanol is a versatile compound with potential utility in various chemical applications.

Formula: C₈H₁₆O₃

InChI: InChI=1S/C8H16O3/c1-3-8(4-2)10-6-7(5-9)11-8/h7,9H,3-6H2,1-2H3

InChI key: InChIKey=WEIVFXLGBXCVEF-UHFFFAOYSA-N

SMILES: C(C)C1(CC)OC(CO)CO1

Synonyms:

• (2,2-Diethyl-1,3-dioxolan-4-yl)methanol
• 2,2-Diethyl-4-(hydroxymethyl)-1,3-dioxolane
• 2,2-Diethyl-1,3-dioxolane-4-methanol
• 1,3-Dioxolane-4-methanol, 2,2-diethyl-