CAS 5694-95-1

4-tert-butyl-N'-phenylbenzenesulfonohydrazide

Description:

4-tert-butyl-N'-phenylbenzenesulfonohydrazide is an organic compound characterized by its sulfonohydrazide functional group, which is derived from the reaction of a sulfonic acid with hydrazine. This compound features a tert-butyl group, which is a bulky substituent that can influence its solubility and reactivity. The presence of the phenyl group indicates that it has aromatic characteristics, contributing to its stability and potential applications in various chemical reactions. The sulfonohydrazide structure suggests that it may exhibit properties such as being a potential reagent in organic synthesis, particularly in the formation of azo compounds or as a precursor in the synthesis of other functionalized materials. Additionally, compounds of this nature can be explored for their biological activities, including potential antimicrobial or anti-inflammatory properties. Its CAS number, 5694-95-1, allows for easy identification and reference in chemical databases. Overall, 4-tert-butyl-N'-phenylbenzenesulfonohydrazide is a versatile compound with applications in both synthetic chemistry and potentially in pharmaceuticals.

Formula: C₁₆H₂₀N₂O₂S

InChI: InChI=1/C16H20N2O2S/c1-16(2,3)13-9-11-15(12-10-13)21(19,20)18-17-14-7-5-4-6-8-14/h4-12,17-18H,1-3H3

SMILES: CC(C)(C)c1ccc(cc1)S(=O)(=O)NNc1ccccc1

1,3-DIOXOLANE-2,2-DIETHANOL

CAS: 5694-95-1

Formula: C₇H₁₄O₄

Purity: 95%

Color and Shape: Liquid

Molecular weight: 162.1837

Ref: IN-DA00E9QU

2,2'-(1,3-Dioxolane-2,2-diyl)diethanol

CAS: 5694-95-1

2,2'-(1,3-Dioxolane-2,2-diyl)diethanol

Purity: 98%

Molecular weight: 162.18g/mol

Ref: 54-OR76848

2,2′-(1,3-Dioxolane-2,2-diyl)diethanol

CAS: 5694-95-1

Formula: C₇H₁₄O₄

Purity: 95%

Color and Shape: Liquid

Molecular weight: 162.185

Ref: 10-F225543