CAS 56961-05-8
:2,6-dichloro-N,N-dimethylaniline
Description:
2,6-Dichloro-N,N-dimethylaniline is an organic compound characterized by its aromatic amine structure, featuring two chlorine atoms substituted at the 2 and 6 positions of the aniline ring, along with two methyl groups attached to the nitrogen atom. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its moderate solubility in organic solvents and limited solubility in water, which is common for many chlorinated aromatic compounds. The presence of chlorine atoms enhances its reactivity, making it useful in various chemical syntheses, particularly in the production of dyes and pigments. Additionally, 2,6-dichloro-N,N-dimethylaniline may exhibit toxicological properties, necessitating careful handling and adherence to safety protocols in laboratory and industrial settings. Its applications extend to the fields of organic chemistry and materials science, where it serves as an intermediate in the synthesis of more complex molecules.
Formula:C8H9Cl2N
InChI:InChI=1/C8H9Cl2N/c1-11(2)8-6(9)4-3-5-7(8)10/h3-5H,1-2H3
Synonyms:- 2,6-Dichloro-N,N-dimethylaniline
- benzenamine, 2,6-dichloro-N,N-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
