CAS 56961-20-7
:3,4,5-trichlorobenzene-1,2-diol
Description:
3,4,5-Trichlorobenzene-1,2-diol, with the CAS number 56961-20-7, is a chlorinated aromatic compound characterized by the presence of three chlorine atoms and two hydroxyl (–OH) groups attached to a benzene ring. This compound typically exhibits a solid state at room temperature and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of multiple chlorine substituents enhances its hydrophobic properties, while the hydroxyl groups contribute to its potential reactivity and solubility in polar solvents. The compound may also exhibit biological activity, which can be of interest in toxicological studies. Its synthesis often involves chlorination reactions and subsequent hydroxylation. As with many chlorinated compounds, 3,4,5-trichlorobenzene-1,2-diol may pose environmental and health risks, necessitating careful handling and disposal. Overall, its unique structure and properties make it a subject of interest in both industrial and research contexts.
Formula:C6H3Cl3O2
InChI:InChI=1/C6H3Cl3O2/c7-2-1-3(10)6(11)5(9)4(2)8/h1,10-11H
SMILES:c1c(c(c(c(c1O)O)Cl)Cl)Cl
Synonyms:- 1,2-Benzenediol, 3,4,5-Trichloro-
- 3,4,5-Trichloro-benzene-1,2-diol
- 3,4,5-Trichlorocatechol
- Pyrocatechol, trichloro-
- Trichloro-1,2-Benzenediol
- Trichloropyrocatechol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
3,4,5-Trichlorocatechol
CAS:3,4,5-Trichlorocatechol is a derivative of catechol that is derived from pentachlorophenol. It is known to induce oxidative lesions in DNA.Formula:C6H3Cl3O2Color and Shape:SolidMolecular weight:213.453,4,5-Trichlorocatechol
CAS:Controlled Product<p>Applications 3,4,5-Trichlorocatechol has found to be toxic to marine algal.<br>References Ertuerk, M.D., et. al.: J. Mol. Graph. Model., 38, 90 (2012)<br></p>Formula:C6H3Cl3O2Color and Shape:Off-WhiteMolecular weight:213.45


