CAS 56961-26-3

2-bromo-3-chlorobenzoic acid

Description:

2-Bromo-3-chlorobenzoic acid is an aromatic carboxylic acid characterized by the presence of both bromine and chlorine substituents on the benzene ring. Specifically, the bromine atom is located at the second position and the chlorine atom at the third position relative to the carboxylic acid group. This compound typically appears as a solid at room temperature and is known for its moderate solubility in organic solvents, while being less soluble in water due to the hydrophobic nature of the aromatic ring and the halogen substituents. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the halogen substituents can influence the compound's reactivity, making it useful in synthetic organic chemistry for the introduction of further functional groups. Its unique structure and properties make 2-bromo-3-chlorobenzoic acid a valuable intermediate in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds.

Formula: C₇H₄BrClO₂

InChI: InChI=1/C7H4BrClO2/c8-6-4(7(10)11)2-1-3-5(6)9/h1-3H,(H,10,11)

SMILES: c1cc(c(c(c1)Cl)Br)C(=O)O

Synonyms:

• Benzoic acid, 2-bromo-3-chloro-
• Bromochlorobenzoic Acid

2-Bromo-3-chlorobenzoicAcid

CAS: 56961-26-3

Formula: C₇H₄BrClO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 235.4625

Ref: IN-DA00EDE2

2-Bromo-3-chlorobenzoic acid

CAS: 56961-26-3

2-Bromo-3-chlorobenzoic acid

Formula: C₇H₄BrClO₂

Purity: 98%

Color and Shape: off white powder

Molecular weight: 235.46g/mol

Ref: 54-OR70080

2-Bromo-3-chlorobenzoic acid

CAS: 56961-26-3

Formula: C₇H₄BrClO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 235.46

Ref: 10-F038275