CAS 56961-27-4

3-Bromo-2-chlorobenzoic acid

Description:

3-Bromo-2-chlorobenzoic acid is an aromatic carboxylic acid characterized by the presence of both bromine and chlorine substituents on the benzene ring. Specifically, the bromine atom is located at the meta position (3-position) relative to the carboxylic acid group, while the chlorine atom is at the ortho position (2-position). This compound typically appears as a white to off-white solid and is sparingly soluble in water, but more soluble in organic solvents such as ethanol and acetone. Its molecular structure contributes to its reactivity, making it useful in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. The presence of halogen atoms can influence the compound's acidity, reactivity, and overall chemical behavior. Additionally, 3-bromo-2-chlorobenzoic acid can participate in electrophilic aromatic substitution reactions, and its derivatives may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.

Formula: C₇H₄BrClO₂

InChI: InChI=1S/C7H4BrClO2/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,(H,10,11)

InChI key: InChIKey=LNURMIDMOXCNEH-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(Cl)C(Br)=CC=C1

Synonyms:

• 2-chloro-3-Bromor-benzoic acid
• 3-Bromo-2-Chlorobenzaldehyde
• Benzoic Acid, 3-Bromo-2-Chloro-
• 3-BROMO-2-CHLOROBENZOIC ACID
• 3-Bromo-2-chlorobenzoic acid

3-Bromo-2-chlorobenzoic acid

CAS: 56961-27-4

Formula: C₇H₄BrClO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 235.4625

Ref: IN-DA003J07

3-Bromo-2-chlorobenzoic acid

CAS: 56961-27-4

3-Bromo-2-chlorobenzoic acid

Formula: C₇H₄BrClO₂

Purity: ≥95%

Color and Shape: off-white crystalline needles

Molecular weight: 235.46g/mol

Ref: 54-OR303214

3-Bromo-2-chlorobenzoic acid

CAS: 56961-27-4

Formula: C₇H₄BrClO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 235.46

Ref: 10-F062765