CAS 56961-30-9: 2-Chloro-5-hydroxybenzoic acid
Description:2-Chloro-5-hydroxybenzoic acid, with the CAS number 56961-30-9, is an aromatic compound characterized by the presence of a chloro group and a hydroxyl group on a benzoic acid framework. This compound features a chlorine atom attached to the second carbon and a hydroxyl group on the fifth carbon of the benzene ring, contributing to its unique chemical properties. It is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the hydroxyl group. The compound exhibits acidic properties, as indicated by the carboxylic acid functional group, which can donate protons in solution. Its structural features allow it to participate in various chemical reactions, including esterification and nucleophilic substitution. Additionally, 2-Chloro-5-hydroxybenzoic acid may have applications in pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis, owing to its reactivity and functional groups. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C7H5ClO3
InChI:InChI=1S/C7H5ClO3/c8-6-2-1-4(9)3-5(6)7(10)11/h1-3,9H,(H,10,11)
InChI key:InChIKey=UTVCLUZQPSRKMY-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC(O)=CC=C1Cl
- Synonyms:
- 2-Chloro-5-hydroxybenzene carboxylic acid
- 2-Chloro-5-hydroxybenzenecarboxylic acid
- 2-Chloro-5-hydroxybenzoicacid
- 4-Chloro-3-carboxyphenol
- Benzoic acid, 2-chloro-5-hydroxy-
- 2-Chloro-5-hydroxybenzoic acid
