CAS 56961-31-0

2-Chloro-6-hydroxybenzoic acid

Description:

2-Chloro-6-hydroxybenzoic acid is an aromatic compound characterized by the presence of a chloro group and a hydroxyl group on a benzoic acid framework. This compound features a chlorine atom at the second position and a hydroxyl group at the sixth position of the benzene ring, contributing to its unique chemical properties. It is typically a white to off-white solid and is soluble in polar solvents due to the presence of the hydroxyl group, which can engage in hydrogen bonding. The compound exhibits acidic properties due to the carboxylic acid functional group, allowing it to donate protons in solution. Its structure makes it a potential candidate for various applications in pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. Additionally, the presence of both the chloro and hydroxy groups can influence its reactivity and interactions with biological systems, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₇H₅ClO₃

InChI: InChI=1S/C7H5ClO3/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3,9H,(H,10,11)

InChI key: InChIKey=QCEPIUWMXRQPIF-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(Cl)C=CC=C1O

Synonyms:

• 6-Chlorosalicylic acid
• Benzoic Acid, 2-Chloro-6-Hydroxy-
• Salicylic acid, 6-chloro-
• 2-Chloro-6-hydroxybenzoic acid

2-chloro-6-hydroxy-Benzoicacid

CAS: 56961-31-0

Formula: C₇H₅ClO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 172.5658

Ref: IN-DA0038N5

2-Chloro-6-hydroxybenzoic acid

CAS: 56961-31-0

2-Chloro-6-hydroxybenzoic acid

Purity: 98%

Molecular weight: 172.57g/mol

Ref: 54-OR907056

2-Chloro-6-hydroxybenzoic acid

CAS: 56961-31-0

Formula: C₇H₅ClO₃

Purity: 95%

Color and Shape: White powder

Molecular weight: 172.56

Ref: 10-F078206