CAS 56961-33-2

3-Chloro-5-methylbenzoic acid

Description:

3-Chloro-5-methylbenzoic acid is an aromatic carboxylic acid characterized by the presence of a chlorine atom and a methyl group attached to a benzoic acid framework. The chlorine atom is located at the meta position (3-position) relative to the carboxylic acid group, while the methyl group is situated at the para position (5-position). This compound typically appears as a white to off-white solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic aromatic structure. It exhibits acidic properties, allowing it to donate protons in solution. The presence of the chlorine atom can influence its reactivity, making it a useful intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit specific biological activities, which can be explored in various chemical and biological research contexts. Safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled.

Formula: C₈H₇ClO₂

InChI: InChI=1/C8H7ClO2/c1-5-2-6(8(10)11)4-7(9)3-5/h2-4H,1H3,(H,10,11)

SMILES: Cc1cc(cc(c1)Cl)C(=O)O

Synonyms:

• Benzoic acid, 3-chloro-5-methyl-
• 3-Chloro-5-Methyl-Benzoic Acid

3-Chloro-5-methylbenzoic acid

CAS: 56961-33-2

Formula: C₈H₇ClO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 170.5930

Ref: IN-DA0033O5

3-Chloro-5-methylbenzoic acid

CAS: 56961-33-2

3-Chloro-5-methylbenzoic acid

Purity: 98%

Color and Shape: Off-White Solid

Molecular weight: 170.59g/mol

Ref: 54-OR19520

3-Chloro-5-methylbenzoic acid

CAS: 56961-33-2

Formula: C₈H₇ClO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 170.59

Ref: 10-F037650