CAS 56961-78-5

2,4-Dichloro-5-methylpyridine

Description:

2,4-Dichloro-5-methylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with two chlorine atoms and a methyl group. Its molecular formula is C6H5Cl2N, indicating the presence of five carbon atoms, five hydrogen atoms, two chlorine atoms, and one nitrogen atom. This compound typically appears as a colorless to pale yellow liquid with a distinct odor. It is soluble in organic solvents but has limited solubility in water. 2,4-Dichloro-5-methylpyridine is primarily used in the synthesis of agrochemicals, pharmaceuticals, and other fine chemicals. It exhibits properties such as moderate toxicity and potential environmental impact, necessitating careful handling and disposal. The compound's reactivity is influenced by the electron-withdrawing effects of the chlorine substituents, making it a useful intermediate in various chemical reactions. Safety data sheets recommend using appropriate personal protective equipment when handling this substance due to its potential health hazards.

Formula: C₆H₅Cl₂N

InChI: InChI=1/C6H5Cl2N/c1-4-3-9-6(8)2-5(4)7/h2-3H,1H3

SMILES: Cc1cnc(cc1Cl)Cl

Synonyms:

• 2,4-Dichloro-5-picoline

2,4-Dichloro-5-methylpyridine

CAS: 56961-78-5

Formula: C₆H₅Cl₂N

Purity: 96%

Color and Shape: Liquid

Molecular weight: 162.0166

Ref: IN-DA00E918

2,4-Dichloro-5-methylpyridine

CAS: 56961-78-5

2,4-Dichloro-5-methylpyridine

Formula: C₆H₅Cl₂N

Purity: 98%

Color and Shape: colourless liquid

Molecular weight: 162.02g/mol

Ref: 54-OR301066

2,4-Dichloro-5-picoline

CAS: 56961-78-5

Formula: C₆H₅Cl₂N

Purity: 95.0%

Color and Shape: Liquid

Molecular weight: 162.01

Ref: 10-F078548