CAS 56961-84-3
:1,2-Dichloro-4-(dichloromethyl)benzene
Description:
1,2-Dichloro-4-(dichloromethyl)benzene, with the CAS number 56961-84-3, is an organic compound belonging to the class of chlorinated aromatic hydrocarbons. It features a benzene ring substituted with two chlorine atoms at the 1 and 2 positions, and a dichloromethyl group at the 4 position. This compound is typically a colorless to pale yellow liquid with a characteristic odor. It is known for its relatively low solubility in water but is soluble in organic solvents such as acetone and ether. The presence of multiple chlorine atoms contributes to its chemical stability and potential for bioaccumulation in the environment. 1,2-Dichloro-4-(dichloromethyl)benzene is primarily used in industrial applications, including as an intermediate in the synthesis of other chemical compounds. However, due to its chlorinated nature, it may pose environmental and health risks, necessitating careful handling and disposal. Its properties make it relevant in studies related to environmental chemistry and toxicology.
Formula:C7H4Cl4
InChI:InChI=1S/C7H4Cl4/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,7H
InChI key:InChIKey=LLPBAWYATBAOQG-UHFFFAOYSA-N
SMILES:C(Cl)(Cl)C1=CC(Cl)=C(Cl)C=C1
Synonyms:- Benzene, 1,2-dichloro-4-(dichloromethyl)-
- 1,2-Dichloro-4-(dichloromethyl)benzene
- 1,2-Dichloro-4-(dichloromethyl)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
