CAS 569660-97-5
:(R)-tert-Butyl 3-bromopyrrolidine-1-carboxylate
Description:
(R)-tert-Butyl 3-bromopyrrolidine-1-carboxylate is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The presence of a tert-butyl group enhances its lipophilicity, making it more soluble in organic solvents. The bromine atom at the 3-position introduces a halogen functionality, which can participate in various chemical reactions, such as nucleophilic substitutions. The carboxylate group at the 1-position contributes to the compound's reactivity and can serve as a site for further functionalization. This compound is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its potential as a building block in the synthesis of more complex molecules. Its chirality, indicated by the (R) configuration, suggests that it may exhibit specific biological activity, making it of interest in medicinal chemistry. Overall, (R)-tert-Butyl 3-bromopyrrolidine-1-carboxylate is a versatile compound with significant implications in synthetic organic chemistry.
Formula:C9H16NO2Br
InChI:InChI=1S/C9H16BrNO2/c1-9(2,3)13-8(12)11-5-4-7(10)6-11/h7H,4-6H2,1-3H3/t7-/m1/s1
SMILES:CC(C)(C)OC(=O)N1CC[C@H](C1)Br
Synonyms:- (R)-3-Bromo-pyrrolidine-1-carboxylic acid tert-butyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(R)-(-)-1-Boc-3-bromopyrrolidine, 95%
CAS:It is used as a pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed asFormula:C9H16BrNO2Purity:95%Molecular weight:250.14(R)-tert-Butyl 3-bromopyrrolidine-1-carboxylate
CAS:Formula:C9H16BrNO2Purity:96%Color and Shape:SolidMolecular weight:250.1328(R)-3-Bromo-pyrrolidine-1-carboxylic acid tert-butyl ester
CAS:Formula:C9H16BrNO2Purity:96%Color and Shape:SolidMolecular weight:250.136[R]-1-Boc-3-Bromopyrrolidine
CAS:Versatile small molecule scaffoldFormula:C9H16BrNO2Purity:Min. 95%Molecular weight:250.14 g/mol




