CAS 56970-78-6
:2-Methyl-3-Bromopropionic Acid
Description:
2-Methyl-3-bromopropionic acid is an organic compound characterized by its carboxylic acid functional group and a bromine atom attached to the carbon chain. It has a molecular formula of C4H7BrO2 and features a branched structure, which contributes to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid and is soluble in polar solvents like water and alcohols due to the presence of the carboxylic acid group. Its bromine substituent enhances its reactivity, making it useful in various organic synthesis applications, including the preparation of pharmaceuticals and agrochemicals. The presence of the methyl group introduces steric hindrance, which can influence its reactivity and interaction with other molecules. Additionally, 2-methyl-3-bromopropionic acid can undergo typical reactions associated with carboxylic acids, such as esterification and acid-base reactions. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled, and proper storage conditions should be maintained to ensure stability.
Formula:C5H9BrO2
InChI:InChI=1/C5H9BrO2/c1-4(3-6)5(7)8-2/h4H,3H2,1-2H3
SMILES:CC(CBr)C(=O)OC
Synonyms:- 3-Bromo-2-Methylpropanoic Acid
- Methyl 3-Bromo-2-Methylpropanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
3-Bromoisobutyric Acid
CAS:Formula:C4H7BrO2Purity:>97.0%(GC)(T)Color and Shape:Colorless to Light orange to Yellow clear liquidMolecular weight:167.003-Bromo-2-methylpropanoic acid
CAS:Formula:C4H7BrO2Purity:95%Color and Shape:LiquidMolecular weight:167.00123-Bromo-2-methylpropionic acid
CAS:3-Bromo-2-methylpropionic acidPurity:99%Molecular weight:167.00g/mol(2RS)-3-Bromo-2-methyl-propanoic Acid
CAS:Controlled ProductFormula:C4H7BrO2Color and Shape:NeatMolecular weight:167.003-Bromo-2-methylpropanoic acid
CAS:Formula:C4H7BrO2Purity:95%Color and Shape:Liquid, ClearMolecular weight:167.0023-Bromo-2-methylpropionic Acid
CAS:Impurity Captopril EP Impurity D
Stability Hygroscopic
Applications 3-Bromo-2-methylpropionic Acid (Captopril EP Impurity D) is used in the preparation of captopril selenium analogs as antioxidants and ACE inhibitors used as antihypertensive drugs.
References Bhuyan, B. et al.: Org. Biomol. Chem., 9, 1356 (2011);Formula:C4H7BrO2Color and Shape:Colourless LiquidMolecular weight:167.00








