CAS 56970-91-3
:pyridin-2-yl(pyridin-3-yl)methanone
Description:
Pyridin-2-yl(pyridin-3-yl)methanone, also known by its CAS number 56970-91-3, is an organic compound characterized by the presence of two pyridine rings and a ketone functional group. This compound features a methanone group (C=O) attached to a carbon that is also bonded to two pyridine moieties, specifically at the 2 and 3 positions of the rings. Pyridine is a six-membered aromatic ring containing one nitrogen atom, which contributes to the compound's basicity and potential for coordination with metal ions. The presence of the ketone group introduces polar characteristics, influencing its solubility and reactivity. Pyridin-2-yl(pyridin-3-yl)methanone may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in various fields, including pharmaceuticals and agrochemicals, due to the unique properties imparted by the pyridine rings and the ketone functionality. As with many organic compounds, its behavior in reactions and interactions with other substances can be influenced by environmental conditions such as pH and temperature.
Formula:C11H8N2O
InChI:InChI=1/C11H8N2O/c14-11(9-4-3-6-12-8-9)10-5-1-2-7-13-10/h1-8H
SMILES:c1ccnc(c1)C(=O)c1cccnc1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-(Pyridine-2-carbonyl)pyridine
CAS:3-(Pyridine-2-carbonyl)pyridine is a ligand that binds to metal cations and anions. This ligand has been shown to have a helical structure, which allows it to interact with the metal cations. 3-(Pyridine-2-carbonyl)pyridine forms an anion in solution, which can be stabilized by interaction with a metal cation. The interactions between these ligands and metal cations are highly dependent on their conformations, as well as their bonding and geometry. 3-(Pyridine-2-carbonyl)pyridine has been shown to be stable in the solid state when interacting with perchlorate ions. These interactions are also reversible and can be used for docking studies of various compounds.Formula:C11H8N2OPurity:Min. 95%Molecular weight:184.19 g/mol

