CAS 56973-41-2

Withanolide B

Description:

Withanolide B is a naturally occurring steroidal lactone classified as a withanolide, which is a type of compound derived from the Solanaceae family, particularly from the plant genus Withania, such as Withania somnifera (commonly known as ashwagandha). It is characterized by its complex structure, which includes a steroid backbone with a lactone ring and various functional groups that contribute to its biological activity. Withanolide B exhibits a range of pharmacological properties, including anti-inflammatory, antioxidant, and potential anticancer effects, making it of interest in medicinal chemistry and pharmacology. The compound has been studied for its ability to modulate various signaling pathways and its effects on cellular processes. In terms of solubility, withanolides are generally lipophilic, which influences their bioavailability and interaction with biological membranes. Overall, Withanolide B represents a significant compound in the field of natural products and herbal medicine, with ongoing research into its therapeutic potential and mechanisms of action.

Formula: C₂₈H₃₈O₅

InChI: InChI=1S/C28H38O5/c1-14-13-20(32-25(30)15(14)2)16(3)17-8-9-18-22-19(10-12-26(17,18)4)27(5)21(29)7-6-11-28(27,31)24-23(22)33-24/h6-7,16-20,22-24,31H,8-13H2,1-5H3/t16-,17+,18-,19-,20+,22-,23-,24-,26+,27-,28-/m0/s1

InChI key: InChIKey=ZTEVDTFJUUJBLP-MBMSZCMESA-N

SMILES: C[C@@]12[C@@]3([C@@]([C@]4([C@](O4)([C@@]1(O)CC=CC2=O)[H])[H])([C@]5([C@](C)(CC3)[C@@]([C@H](C)[C@]6(CC(C)=C(C)C(=O)O6)[H])(CC5)[H])[H])[H])[H]

Synonyms:

• Ergosta-2,24-dien-26-oic acid, 6,7-epoxy-5,22-dihydroxy-1-oxo-, δ-lactone, (5α,6α,7α,22R)-
• Lycium substance B
• Lyciumsubstance B
• Withanolide B

WITHANOLIDE B(P)(NEW)

CAS: 56973-41-2

Formula: C₂₈H₃₈O₅

Purity: 98%

Molecular weight: 454.5983

Ref: IN-DA00EGN0

Withanolide B

CAS: 56973-41-2

Formula: C₂₈H₃₈O₅

Purity: 95%~99%

Molecular weight: 454.607

Ref: BP-BP5279

Withanolide B

CAS: 56973-41-2

Formula: C₂₈H₃₈O₅

Molecular weight: 454.61

Ref: 4Z-W-008002

Withanolide b

CAS: 56973-41-2

Lactone

Formula: C₂₈H₃₈O₅

Purity: ≥ 90.0 % (HPLC)

Color and Shape: Powder

Molecular weight: 454.61

Ref: 5G-80557

Withanolide B

CAS: 56973-41-2

Natural steroid with anti-neurodegenerative properties

Purity: Min. 95%

Ref: 3D-XW164989

Withanolide B

CAS: 56973-41-2

Withanolide B, a natural product, promotes osteogenic differentiation of human bone marrow-derived mesenchymal stem cells (hBMSCs).

Formula: C₂₈H₃₈O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 454.60

Ref: TM-TN2310