CAS 56976-66-0

4-(2,5-dioxo-4,4-diphenyl-imidazolidin-1-yl)butanoic acid

Description:

4-(2,5-Dioxo-4,4-diphenyl-imidazolidin-1-yl)butanoic acid, with the CAS number 56976-66-0, is a chemical compound characterized by its imidazolidinone structure, which features a butanoic acid moiety. This compound typically exhibits properties associated with both the imidazolidinone and carboxylic acid functional groups, including potential acidity due to the carboxylic acid group and the ability to participate in hydrogen bonding due to the presence of the carbonyl groups in the imidazolidinone ring. The diphenyl substituents contribute to its hydrophobic character, which may influence its solubility in organic solvents. Additionally, the presence of multiple functional groups suggests potential reactivity, making it of interest in various chemical synthesis applications, including pharmaceuticals and materials science. Its unique structure may also impart specific biological activities, warranting further investigation into its potential uses in medicinal chemistry. Overall, this compound exemplifies the complexity and versatility of organic molecules in chemical research and application.

Formula: C₁₉H₁₈N₂O₄

InChI: InChI=1/C19H18N2O4/c22-16(23)12-7-13-21-17(24)19(20-18(21)25,14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-11H,7,12-13H2,(H,20,25)(H,22,23)

SMILES: c1ccc(cc1)C1(c2ccccc2)C(=O)N(CCCC(=O)O)C(=N1)O

5,5-Diphenylhydantoin-3-butyric Acid

Controlled Product

CAS: 56976-66-0

Formula: C₁₉H₁₈N₂O₄

Color and Shape: Neat

Molecular weight: 338.36

Ref: TR-D491680

5,5-Diphenylhydantoin-3-butyric acid

CAS: 56976-66-0

5,5-Diphenylhydantoin-3-butyric acid is a drug that is classified as a hydantoin derivative. It has been shown to be an active compound in the treatment of human brain tumors. This drug has also been found to be detectable in human serum and urine by means of electrochemical immunoassay.

Formula: C₁₉H₁₈N₂O₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 338.36 g/mol

Ref: 3D-FD22498