CAS 56979-35-2
:N~2~-[(benzyloxy)carbonyl]-N-[(2S)-4-chloro-1-(4-hydroxyphenyl)-3-oxobutan-2-yl]-L-leucinamide
Description:
The chemical substance known as N~2~-[(benzyloxy)carbonyl]-N-[(2S)-4-chloro-1-(4-hydroxyphenyl)-3-oxobutan-2-yl]-L-leucinamide, with the CAS number 56979-35-2, is a synthetic compound that belongs to the class of amino acid derivatives. It features a complex structure characterized by the presence of a leucine amino acid moiety, a benzyloxycarbonyl protecting group, and a chloro-substituted ketone side chain. This compound exhibits properties typical of peptide-like structures, including potential biological activity, which may involve interactions with specific enzymes or receptors. Its molecular structure suggests it may be involved in various biochemical pathways, possibly as an inhibitor or modulator. The presence of functional groups such as the benzyloxy and chloro groups indicates potential for reactivity and specificity in biological systems. Additionally, the compound's stereochemistry, particularly the (2S) configuration, is crucial for its biological activity and interaction with biological targets. Overall, this compound's unique characteristics make it of interest in medicinal chemistry and drug development.
Formula:C24H29ClN2O5
InChI:InChI=1/C24H29ClN2O5/c1-16(2)12-21(27-24(31)32-15-18-6-4-3-5-7-18)23(30)26-20(22(29)14-25)13-17-8-10-19(28)11-9-17/h3-11,16,20-21,28H,12-15H2,1-2H3,(H,26,30)(H,27,31)/t20-,21-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Z-Leu-Tyr-chloromethylketone
CAS:Z-LY-CMK, E.coli ClpP inhibitor.Formula:C24H29ClN2O5Purity:98.4%Color and Shape:WhiteMolecular weight:460.96Z-Leu-Tyr-Chloromethylketone
CAS:Z-Leu-Tyr-Chloromethylketone is a calpain inhibitor [1].Formula:C24H29ClN2O5Color and Shape:SolidMolecular weight:460.95Z-Leu-Tyr-chloromethylketone
CAS:<p>Z-Leu-Tyr-chloromethylketone is a peptide that binds to the reticulum and prevents the release of calcium ions. It is a chloromethyl ketone, which inhibits the L-type calcium channels in cells. Z-Leu-Tyr-chloromethylketone has been shown to block the influx of calcium ions into cytosolic compartments. This process leads to inhibition of protein synthesis and cell death by apoptosis.</p>Formula:C24H29ClN2O5Purity:Min. 95%Molecular weight:460.95 g/mol


