CAS 56980-94-0
:1-[5-Amino-2-[3-[(1,1-dimethylethyl)amino]-2-hydroxypropoxy]phenyl]ethanone
Description:
1-[5-Amino-2-[3-[(1,1-dimethylethyl)amino]-2-hydroxypropoxy]phenyl]ethanone, with the CAS number 56980-94-0, is a chemical compound characterized by its complex structure, which includes an ethanone moiety and multiple functional groups such as an amino group and a hydroxypropoxy chain. This compound is typically classified as an organic amine and may exhibit properties such as solubility in polar solvents due to the presence of hydroxyl and amino groups. Its structure suggests potential applications in pharmaceuticals or as a biochemical probe, given the presence of functional groups that can participate in various chemical reactions. The compound's stability, reactivity, and biological activity would depend on its specific molecular interactions and the environment in which it is used. As with many organic compounds, safety and handling precautions are essential, particularly due to the potential for biological activity associated with its amine functionality. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.
Formula:C15H24N2O3
InChI:InChI=1/C15H24N2O3/c1-10(18)13-7-11(16)5-6-14(13)20-9-12(19)8-17-15(2,3)4/h5-7,12,17,19H,8-9,16H2,1-4H3
InChI key:InChIKey=NDSFAFIRRXLJNE-UHFFFAOYSA-N
SMILES:O(CC(CNC(C)(C)C)O)C1=C(C(C)=O)C=C(N)C=C1
Synonyms:- 1-[5-Amino-2-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]ethanone
- 1-[5-Amino-2-[3-[(1,1-dimethylethyl)amino]-2-hydroxypropoxy]phenyl]ethanone
- 3-Acetyl-4-[3-(1,1-Dimethylethylamino)-2-Hydroxy-propoxy]aniline
- Ethanone, 1-[5-amino-2-[3-[(1,1-dimethylethyl)amino]-2-hydroxypropoxy]phenyl]-
- N 112
- Celiprolol Impurity 1
- 5-Amino-2-(3-(tert-butylamino)-2-hydroxypropoxy)acetophenone
- 1-[5-Amino-2-[(2RS)-3-[(1,1-dimethy
- Celiprolol Impurity A
- Celiprolol hydrochloride impurity A
- Celiprolol EP Impurity A
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Celiprolol EP Impurity A
CAS:Formula:C15H24N2O3Color and Shape:Pale Yellow SolidMolecular weight:280.37Celiprolol EP Impurity A
CAS:Controlled ProductFormula:C15H24N2O3Color and Shape:NeatMolecular weight:280.365-Amino-2-(3-(tert-butylamino)-2-hydroxypropoxy)acetophenone
CAS:Applications Celiprolol intermediate.
Formula:C15H24N2O3Color and Shape:NeatMolecular weight:280.36



