CAS 56987-35-0
:3,3-dibromoazepan-2-one
Description:
3,3-Dibromoazepan-2-one is a chemical compound characterized by its seven-membered ring structure, specifically an azepane, which is a saturated cyclic amine. The presence of two bromine atoms at the 3-position of the ring significantly influences its reactivity and properties. The carbonyl group (C=O) at the 2-position contributes to its classification as a ketone, which can participate in various chemical reactions, including nucleophilic additions. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents due to the presence of the carbonyl group. Its bromine substituents can enhance its electrophilic character, making it useful in synthetic organic chemistry for further functionalization. Additionally, the compound may exhibit biological activity, which could be of interest in medicinal chemistry. Safety precautions should be taken when handling this compound, as brominated compounds can be hazardous. Overall, 3,3-dibromoazepan-2-one is a versatile building block in organic synthesis with potential applications in various fields.
Formula:C6H9Br2NO
InChI:InChI=1/C6H9Br2NO/c7-6(8)3-1-2-4-9-5(6)10/h1-4H2,(H,9,10)
SMILES:C1CCN=C(C(C1)(Br)Br)O
Synonyms:- 3,3-DIBROMO-4,5,6,7-TETRAHYDRO-1H-AZEPIN-2(3H)-ONE
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,3-DIBROMO-4,5,6,7-TETRAHYDRO-1H-AZEPIN-2(3H)-ONE
CAS:Formula:C6H9Br2NOPurity:98%Color and Shape:SolidMolecular weight:270.94983,3-Dibromo-azepan-2-one
CAS:<p>3,3-Dibromo-azepan-2-one is a molecule that has been shown to inhibit cancer cell growth in the nanomolar range. It acts by binding to a specific site on the enzyme protein which prevents the synthesis of new proteins and causes cellular apoptosis. This molecule has shown high specificity for prostate cancer cells, but it may also be effective against other cancers. 3,3-Dibromo-azepan-2-one has been modified to improve its pharmacological properties and it is being screened for anti-cancer activity in animals.</p>Formula:C6H9Br2NOPurity:Min. 95%Molecular weight:270.95 g/mol
